3^x+3^(4-2x)=1+3^(4-x)

Answers

Answer 1

The solution to the equation [tex]3^x + 3^(4-2x) = 1 + 3^(4-x) is x = 2.[/tex]

To solve the equation [tex]3^x + 3^(4-2x) = 1 + 3^(4-x),[/tex] we can simplify the equation and then apply some algebraic techniques to isolate the variable x.

First, let's simplify the equation step by step:

1. Notice that [tex]3^(4-2x)[/tex] can be rewritten as[tex](3^4) / (3^2x)[/tex], using the property of exponentiation.

2. Now the equation becomes 3[tex]^x + (81 / 9^x) = 1 + 3^(4-x).[/tex]

3. We can simplify further by multiplying both sides of the equation by 9^x to eliminate the denominators.

  This gives us [tex]3^x * 9^x + 81 = 9^x + 3^(4-x) * 9^x.[/tex]

4. Simplifying the terms, we have [tex](3*9)^x + 81 = 9^x + (3*9)^(4-x).[/tex]

  Now we have [tex](27)^x + 81 = 9^x + (27)^(4-x).[/tex]

5. Notice that [tex](27)^x and (27)^(4-x)[/tex] have the same base, so we can set the exponents equal to each other.

  This gives us x = 4 - x.

6. Simplifying the equation, we get 2x = 4.

7. Dividing both sides of the equation by 2, we have x = 2.

Therefore, the solution to the equation [tex]3^x + 3^(4-2x) = 1 + 3^(4-x) is x = 2.[/tex]

Using simple language, we simplified the equation step by step and isolated the variable x by setting the exponents equal to each other. The final solution is x = 2.

for more such question on equation  visit

https://brainly.com/question/17145398

#SPJ8


Related Questions

The lines shown below are parallel. if the green line has a slope of 3 what is the slope of the red line?

Answers

Answer:

3

Step-by-step explanation:

parallel lines have the same gradient

The grocery store has bulk pecans on sale, which is great since you're planning on making 9 pecan pies for a wedding. How many pounds of pecans should you buy?

First, determine what information you need to answer this question, then click here to display that info (along with other info).

How many pecans are needed for each pie? Your recipe calls for

cups pecans per pie. But there is no cup measure available, only a scale.
How many pecans are in a pound? Perhaps the nutritional info from a bag of pecans would be helpful.

Answers

Approximately 4.6 pounds of pecans are needed for one pecan pie.You should buy approximately 41.4 pounds of pecans to make 9 pecan pies.

To determine the number of pounds of pecans needed to make 9 pecan pies, we need to consider the amount of pecans required per pie and the number of pies we are making.

The recipe calls for 1 cup of pecans per pie, but we don't have a measuring cup available. However, we do have nutritional information from a bag of pecans, which states that there are 684 calories in 1 cup (99g) of pecans.

To find out how many pecans are in a pound, we can use the information that 1 cup of pecans weighs 99 grams. Since there are 454 grams in a pound, we can set up the following proportion:

1 cup (99g) = x pounds (454g)

Cross-multiplying, we get:

99g * x pounds = 1 cup * 454g

Simplifying, we have:

99x = 454

Dividing both sides by 99, we find:

x ≈ 4.5959 pounds

So, approximately 4.6 pounds of pecans are needed for one pecan pie.

Since we are making 9 pecan pies, we multiply the amount needed for one pie by the number of pies:

4.6 pounds/pie * 9 pies = 41.4 pounds

For more such questions on pounds visit:

https://brainly.com/question/12983359

#SPJ8


[tex] \frac{350}{120} [/tex]
me ayudan siiiiiiiiiiiiiii

Answers

The simplified fraction of 350/120 is 35/12

How to simplify the fraction

from the question, we have the following parameters that can be used in our computation:

350/120

Divide the zeros

So, we have

350/120 = 35/12

Divide the fractions by 3

This is impossible

Hence, the simplified fraction is 35/12

Read more about fraction at

https://brainly.com/question/31896427

#SPJ1

Similar Triangles
Determine whether the triangles are similar. If so, write a similarity statement. If not, what would be sufficient to
prove the triangles similar? Explain your reasoning.
I need help on number 1 and 2

Answers

The equivalent ratio of the corresponding sides and the triangle proportionality theorem indicates that the similar triangles are;

1. ΔAJK ~ ΔSWY according to the SAS similarity postulate

2. ΔLMN ~ ΔLPQ according to the AA similarity postulate

3. ΔPQN ~ ΔLMN

LM = 12, QP = 8

4. ΔLMK~ΔLNJ

NL = 21, ML = 14

What are similar triangles?

Similar triangles are triangles that have the same shape but may have different sizes.

1. The ratio of corresponding sides between the two triangles circumscribing the congruent included angle are;

24/16 = 3/2

18/12 = 3/2

The ratio of each of the two sides in the triangle ΔAJK to the corresponding sides in the triangle ΔSWY are equivalent and the included angle, therefore, the triangles ΔAJK and ΔSWY are similar according to the SAS similarity rule.

2. The ratio of the corresponding sides in each of the triangles are;

MN/LN = 8/10 = 4/5

PQ/LQ = 12/(10 + 5) = 12/15 = 4/5

The triangle proportionality theorem indicates that the side MN and PQ are parallel, therefore, the angles ∠LMN ≅ ∠LPQ and ∠LNM ≅ ∠LQP, which indicates that the triangles ΔLMN and ΔLPQ are similar according to the Angle-Angle AA similarity rule

3. The alternate interior angles theorem indicates;

Angles ∠PQN ≅ ∠LMN and ∠MLN ≅ ∠NPQ, therefore;

ΔPQN ~ ΔLMN by the AA similarity postulate

LM/QP = (x + 3)/(x - 1) = 18/12

12·x + 36 = 18·x - 18

18·x - 12·x = 36 + 18 = 54

6·x = 54

x = 54/6 = 9

LM = 9 + 3 = 12

QP = x - 1

QP = 9 - 1 = 8

4. The similar triangles are; ΔLMK and ΔLNJ

ΔLMK ~ ΔLNJ by AA similarity postulate

ML/NL = (6·x + 2)/(6·x + 2 + (x + 5)) = (6·x + 2)/((7·x + 7)

ML/NL = LK/LJ = (24 - 8)/24

(24 - 8)/24 = (6·x + 2)/((7·x + 7)

16/24 = (6·x + 2)/(7·x + 7)

16 × (7·x + 7) = 24 × (6·x + 2)

112·x + 112 = 144·x + 48

144·x - 112·x = 32·x = 112 - 48 = 64

x = 64/32 = 2

ML = 6 × 2 + 2 = 14

NL = 7 × 2 + 7 = 21

MN = 2 + 5 = 7

Learn more on similar triangles here: https://brainly.com/question/2644832

#SPJ1

GEOMETRY 50POINTS

determine what type of triangle they will form.

BRILLIANT for the best answer ​

Answers

Answer:

acute triangle

Step-by-step explanation:

for the given sides to form a triangle

the sum of any 2 sides must be greater than the third side

given 56 , 90 , 100

56 + 90 = 146 > 100

56 + 100 = 156 > 90

90 + 100 = 190 > 56

the condition is met so the 3 lengths will form a triangle.

let a = 56 , b = 90 and c = 100 , where c represents the longest of the 3 sides , then

• if a² + b² = c² , then triangle is right

• if a² + b² > c² , then triangle is acute

• if a² + b² < c² , then triangle is obtuse

a² + b² = 56² + 90² = 3136 + 8100 = 11,236

c² = 100² = 10, 000

since a² + b² > c² , then triangle is acute

Diseases tend to spread according to the exponential growth model. In the early days of AIDS, the growth factor (i.e. common ratio; growth multiplier) was around 1.9. In 1983, about 1600 people in the U.S. died of AIDS. If the trend had continued unchecked, how many people would have died from AIDS in 2003?

Answers

To estimate the number of people who would have died from AIDS in 2003, assuming the exponential growth model with a growth factor of 1.9, we need to calculate the exponential growth from 1983 to 2003.

First, let's calculate the number of years between 1983 and 2003:
2003 - 1983 = 20 years

Using the exponential growth formula:

N = N0 * (growth factor)^t

Where:
N0 is the initial value (number of deaths in 1983)
(growth factor) is the common ratio or growth multiplier
t is the time in years

Given:
N0 = 1600 (number of deaths in 1983)
growth factor = 1.9 (common ratio)
t = 20 (years)

Using the formula, we can calculate:

N = 1600 * (1.9)^20

Calculating this expression:

N ≈ 1600 * 6.1917364224

N ≈ 9907.58

Therefore, if the trend had continued unchecked, approximately 9908 people would have died from AIDS in the U.S. in 2003.

What else would need to be congruent to show that ABC=AXYZ by SAS?

A. ZB=LY
B. BC = YZ
C. C= LZ
D. AC = XZ
Given:
AB XY
BC=YZ

Answers

To show that ABC ≅ AXYZ by SAS, we would need to establish that angle BAC ≅ angle XYZ.

To show that triangles ABC and AXYZ are congruent by the Side-Angle-Side (SAS) criterion, we need to establish that two corresponding sides and the included angle are congruent.

Given AB ≅ XY and BC ≅ YZ, we already have two corresponding sides congruent.

To complete the congruence by the SAS criterion, we need to establish that the included angles are congruent. In this case, the included angle is angle BAC (or angle XYZ).

Therefore, to show that ABC ≅ AXYZ by SAS, we would need to establish that angle BAC ≅ angle XYZ.

None of the answer choices directly addresses the congruence of the angles. So, none of the given options (A, B, C, D) are sufficient to show the congruence of the triangles by SAS.

for such more question on triangles

https://brainly.com/question/14285697

#SPJ8

 Ex is tangent to circle O at point L, and IF is a secant line. If m_FLX = 104°, find
mLKF.

Answers

Answer:

arc LKF = 208°

Step-by-step explanation:

the angle FLX between the tangent and the secant is half the measure of the intercepted arc LKF , then intercepted arc is twice angle FLX , so

arc LKF = 2 × 104° = 208°

The diagonal of rectangle ABCD measures 2 inches in length. What is the length of line segment AB?

Answers

Answer:

AB = √3

Step-by-step explanation:

Since ABCD is a rectangle, all angles are 90°

∠CDA = 90°

⇒ ∠CDB + ∠BDA = 90

⇒ ∠BDA = 60

In ΔABD,

sin(∠BDA) = opposite/ hypotenuse = AB / BD

⇒ sin(60) = AB/2

⇒ AB = 2 sin(60)

⇒ AB = 2 (√3)/2

AB = √3

NEED HELP
Y
B
^^
CX
A
Previous Activity
N
Which would prove that AABC~ AXYZ? Select two
options.
OBA-BC-A
=
YX
YZ XZ
OBA = BC₁ YX
YZ
O
AC
XZ
=
=
BA
XX. YX
AC
BC
BA = AE = 8C
YX
YZ
XZ
OBC=BA ₁ <= XY
ZX
Next Activity

Answers

The conditions that prove that the triangles ΔABC and ΔXYZ are similar, ΔABC ~ ΔXYZ, based on the order of the lettering are;

BA/YX = BC/YZ = AC/XZ

AC/XZ = BA/YX, ∠A ≅ ∠C

What are similar triangles?

Similar triangles are triangles that have the same shape (the same two or all three interior angles in each triangle) but in which may have different sizes.

Triangles are similar if they equivalent ratio for their sides and and if the angles in each triangle are congruent to the angles in the other triangle

Therefore, the conditions that indicates that two triangles are that one triangle is a scaled image of the other triangle, therefore, the ratio of the corresponding sides of the triangles are equivalent, which indicates;

ΔABC is similar to ΔXYZ if we get;

BA/YX = BC/YZ = AC/XZ

A condition that indicates that two triangle are similar is the Side Angle Side, SAS, similarity postulate, which states that two triangles are congruent if the ratio of two corresponding sides are equivalent and the angle between the two sides in the two triangles are congruent, therefore;

ΔABC is similar to ΔXYZ if we get;

AC/XZ = BA/YX, ∠A ≅ ∠X

Learn more on similar triangles here: https://brainly.com/question/29782809

#SPJ1

Determine the​ point(s) at which the given function​ f(x) is continuous.

Answers

Answer: [tex](-\infty, 6) \cup (6, \infty)[/tex]

Step-by-step explanation:

Polynomials are continuous for all reals, so we only need to consider the rational part. Since the denominator is undefined at [tex]x=6[/tex], there is a vertical asymptote at [tex]x=6[/tex].

If f(x)=x+3 and ​g(x)=x^2-2​, find the following.
a.​ f(g(0))
b.​ g(f(0))
c. ​f(g(x))
d.​ g(f(x))
e. ​f(f(​-2))
f. ​g(g(​4))
g.​ f(f(x))
h.​ g(g(x))

Answers

Step-by-step explanation:

a. f(g(0)) = f(0^2 - 2) = f(-2) = -2 + 3 = 1

b. g(f(0)) = g(0+3) = g(3) = 3^2 - 2 = 7

c. f(g(x)) = g(x) + 3 = x^2 - 2 + 3 = x^2 + 1

d. g(f(x)) = f(x)^2 - 2 = (x+3)^2 - 2 = x^2 + 6x + 7

e. f(f(-2)) = f(-2+3) = f(1) = 1+3 = 4

f. g(g(4)) = g(4^2 - 2) = g(14) = 14^2 - 2 = 194

g. f(f(x)) = f(x+3) = (x+3)+3 = x+6

h. g(g(x)) = g(x^2 - 2) = (x^2 - 2)^2 -2 = x^4 - 4x^2 + 2

Joseph wants to factorise the following algebraic expression 3x squared + 6x + 4x + 8 provide yourself with a three-step guide on how to factorise the expression​

Answers

The expression 3x² + 6x + 4x + 8 is factorized as (x + 2)(3x + 4).

To factorize the algebraic expression 3x² + 6x + 4x + 8, you can follow these three steps:

Step 1: Grouping

Group the terms in pairs based on their common factors:

(3x² + 6x) + (4x + 8)

Step 2: Factor out common factors

Factor out the greatest common factor from each group of terms:

3x(x + 2) + 4(x + 2)

Now, we have a common factor of (x + 2) in both terms.

Step 3: Combine the factored terms

Combine the factored terms using the common factor:

(x + 2)(3x + 4)

The expression 3x² + 6x + 4x + 8 is factorized as (x + 2)(3x + 4).

In this process, we grouped the terms with similar variables and then factored out the greatest common factor from each group. Finally, we combined the factored terms using the common factor to obtain the fully factorized expression.

It's important to note that factoring algebraic expressions requires practice and familiarity with common factoring techniques. In some cases, you may encounter expressions that require additional methods such as factoring by grouping, using special factoring formulas, or applying quadratic factoring techniques.

By following these three steps, you can factorize the given expression by identifying common factors and combining terms accordingly.

for more such question on factorized  visit

https://brainly.com/question/25829061

#SPJ8


a) 9-12/2
b) 27-13/²2

Answers

a) Option a) 9 - 1/2 is equal to 17/2.

b) Option b) 27 - 2/3 is equal to 79/3.

a) The expression 9 - 1/2 can be simplified by finding a common denominator for the terms. The common denominator for 9 and 1/2 is 2.

Multiplying 9 by 2/2, we get:

9 * (2/2) = 18/2

So, the expression 9 - 1/2 can be simplified to:

18/2 - 1/2 = 17/2

Therefore, option a) 9 - 1/2 is equal to 17/2.

b) The expression 27 - 2/3 can be simplified in a similar manner by finding a common denominator for the terms. The common denominator for 27 and 2/3 is 3.

Multiplying 27 by 3/3, we get:

27 * (3/3) = 81/3

So, the expression 27 - 2/3 can be simplified to:

81/3 - 2/3 = 79/3

Therefore, option b) 27 - 2/3 is equal to 79/3.

for such more question on simplified

https://brainly.com/question/11680269

#SPJ8

GEOMETRY 50POINTS

TYSM​

Answers

Answer:

40, 50, 30 Yes

13, 5, 12 Yes

10, 10, 15 Yes

41, 9, 40 Yes

Step-by-step explanation:

16, 10, 6

10 + 6 = 16

No

40, 50, 30

30 + 40 > 50

Yes

13, 5, 12

5 + 12 > 13

Yes

70, 20, 25

20 + 25 < 70

No

10, 10, 15

10 + 10 >15

Yes

41, 9, 40

9 + 40 > 41

Yes

You are typing a paper. At 4:04pm you have typed 275 words. By 4:18pm you have typed 765 words. Find the rate of change in words per minute. Round your answer to the nearest whole number.

Answers

Answer:

35

Step-by-step explanation:

18-4 = 14 minutes

number of words typed in 14 minutes is 765-275= 490 words

490 words/14 mins= appox 35

Select the sentence that contains no errors in​ subject-verb agreement.
Group of answer choices

Those people whose long lives are about to end feels reassured by this belief.

Those people whose long lives are about to end feel reassured by this belief.

A person whose long life is about to end feel reassured by this belief.

A person whose long life are about to end feels reassured by this belief.

Answers

The sentence that contains no errors in subject-verb agreement is: "Those people whose long lives are about to end feel reassured by this belief."

This sentence correctly matches the plural subject "Those people whose long lives are about to end" with the plural verb "feel." The verb "feel" agrees in number with the subject "people."

The other sentences have subject-verb agreement errors:

"Those people whose long lives are about to end feels reassured by this belief."

The verb "feels" does not agree with the plural subject "Those people." It should be "feel."

"A person whose long life is about to end feel reassured by this belief."

The verb "feel" does not agree with the singular subject "A person." It should be "feels."

"A person whose long life are about to end feels reassured by this belief."

The verb "are" does not agree with the singular subject "A person." It should be "is."

Therefore, the sentence with no errors in subject-verb agreement is: "Those people whose long lives are about to end feel reassured by this belief."

For more such questions on errors

https://brainly.com/question/28771966

#SPJ8

Taking attempt 2 of 2.
Question #1*
Find the measure of the indicated arc
67°
134°

Answers

The measure of the indicated arc angle is 134 degrees.

How to find the measure of arc angle?

The angle subtended by the arc at the centre of the circle is the angle of the arc.

Therefore, the central angle of an arc is the angle at the centre of the circle between the two radii subtended by the arc.

Hence, the central angle is also known as the arc's angular distance.

Therefore, the measure of an arc is the measure of its central angle.

Hence, the measure of the indicated arc is 134 degrees.

learn more on arc angle here: brainly.com/question/30194223

#SPJ1

Determine the limit in the following equation.

Answers

The limit of the expression lim (x² - √x⁴ + 3x²) as x approaches any value is indeterminate (∞ - ∞), except when x approaches zero, where the limit is 0.

How did we get the value?

To find the limit of the expression lim (x² - √x⁴ + 3x²) as x approaches a certain value, we can simplify the expression and evaluate the limit.

First, let's simplify the expression:

lim (x² - √x⁴ + 3x²)

= lim (4x² - x² - √x⁴)

= lim (3x² - √x⁴)

Now, let's consider the behavior of the expression as x approaches a value.

As x approaches any finite value, the term 3x² will approach a finite value.

For the term √x⁴, as x approaches a finite value, the square root of x⁴ will approach the absolute value of x².

Therefore, the limit becomes:

lim (3x² - √x⁴) = lim (3x² - |x²|)

Next, let's consider the different cases as x approaches positive infinity, negative infinity, and zero.

1. As x approaches positive infinity, the term 3x² will tend to positive infinity, and |x²| will also tend to positive infinity. Thus, the expression becomes:

lim (3x² - |x²|) = lim (∞ - ∞)

In this case, the limit is indeterminate (∞ - ∞).

2. As x approaches negative infinity, the term 3x² will tend to positive infinity, and |x²| will also tend to positive infinity. Thus, the expression becomes:

lim (3x² - |x²|) = lim (∞ - ∞)

Again, in this case, the limit is indeterminate (∞ - ∞).

3. As x approaches zero, the term 3x² will tend to zero, and |x²| will also tend to zero. Thus, the expression becomes:

lim (3x² - |x²|) = lim (0 - 0) = 0

Therefore, the limit of the expression lim (x² - √x⁴ + 3x²) as x approaches any value is indeterminate (∞ - ∞), except when x approaches zero, where the limit is 0.

learn more about limit: https://brainly.com/question/29412132

#SPJ1

please answer ASAP I will brainlist

Answers

(a) The average cost in 2010 is $2088.82.

(b) A graph of the function g for the period 2006 to 2015 is: D. graph D.

(c) Assuming that the graph remains accurate, its shape suggest that: B. the average cost increases at a slower rate as time goes on.

How to estimate the average cost in 2011?

Based on the information provided, we can logically deduce that the average annual cost (in dollars) for health insurance in this country can be approximately represented by the following function:

g(x) = -1736.7 + 1661.4Inx

where:

x = 6 corresponds to the year 2006.

For the year 2011, the average cost (in dollars) is given by;

x = (2010 - 2006) + 6

x = 4 + 6

x = 10 years.

Next, we would substitute 10 for x in the function:

g(10) = -1736.7 + 1661.4In(10)

g(10) = $2088.82

Part b.

In order to plot the graph of this function, we would make use of an online graphing tool. Additionally, the years would be plotted on the x-axis while the average annual cost would be plotted on the x-axis of the cartesian coordinate as shown below.

Part c.

Assuming the graph remains accurate, the shape of the graph suggest that the average cost of health insurance increases at a slower rate as time goes on.

Read more on exponential functions here: brainly.com/question/28246301

#SPJ1

Simplify the f(x) and g(x) to get it

Answers

Answer:

(fg)(x)= (x²+6)(x²-x+9)

multiply the terms:

(fg)(x)= x²(x²-x+9) +6(x²-x+9)

add the like terms:

(fg)(x)= (x⁴-x³+9x²)+(6x²-6x+54)

and you get your final answer:

(fg)(x)= x⁴-x³+15x²-6x+54

so in the same Equation i have to do use the values x=-4,0,5 to verify my solution to the equation 5+x-12=x-7 in my final answer.

5+x-12=2x-7
x-7=2x-7
x-7+7=2x-7+7
x=2x
x-2x=2x-2x
-x=0
--- ---
-1 -1
x=0
--
-1
x=0

Answers

Answer:

Step-by-step explanation:

Let's revisit the equation and the solution using the values x = -4, 0, and 5.

The given equation is: 5 + x - 12 = x - 7

Let's go through the steps again to solve it:

5 + x - 12 = x - 7

Combine like terms:

x - 7 = x - 7

Now, subtract x from both sides:

x - x - 7 = x - x - 7

Simplify:

-7 = -7

The equation simplifies to -7 = -7, which is true.

Now, let's use the values x = -4, 0, and 5 to verify the solution.

For x = -4:

5 + (-4) - 12 = (-4) - 7

-11 = -11

The equation is satisfied for x = -4.

For x = 0:

5 + 0 - 12 = 0 - 7

-7 = -7

The equation is satisfied for x = 0.

For x = 5:

5 + 5 - 12 = 5 - 7

-2 = -2

The equation is satisfied for x = 5.

Therefore, the solution x = 0 is correct, and it satisfies the equation for the given values. My earlier statement that x = -4 and x = 5 do not satisfy the equation was incorrect. I apologize for the confusion caused.

Data was collected for 300 fish from the North Atlantic. The length of the fish (in mm) is summarized in the GFDT below

Answers

Part 1- The lower class boundary for the first class is 100.

Part 2- Approximately 75% of students take exactly two courses.

Part 1:

To find the lower class boundary for the first class, we need to consider the given class intervals. The lower class boundary is the smallest value within each class interval.

Given the class intervals:

100 - 104

105 - 109

110 - 114

115 - 119

120 - 124

125 - 129

130 - 134

The lower class boundary for the first class interval (100 - 104) would be 100.

So, the lower class boundary for the first class is 100.

Part 2:

To determine the percentage of students who take exactly two courses, we need to calculate the relative frequency for that particular category.

Given the data:

of Courses Frequency Relative Frequency Cumulative Frequency

1 23 0.4423 23

2 - 39

3 13 0.25 -

We can see that the cumulative frequency for the second class (2 courses) is 39. To find the relative frequency for this class, we need to divide the frequency by the total number of students surveyed, which is 52.

Relative Frequency = Frequency / Total Number of Students

Relative Frequency for 2 courses = 39 / 52 ≈ 0.75 (rounded to 4 decimal places)

To convert this to a percentage, we multiply the relative frequency by 100.

Percentage of students taking exactly two courses = 0.75 * 100 ≈ 75%

Therefore, approximately 75% of students take exactly two courses.

for such more question on lower class boundary

https://brainly.com/question/7949481

#SPJ8

Question

Part 1.

Data was collected for 300 fish from the North Atlantic. The length of the fish (in mm) is summarized in the GFDT below.

Lengths (mm) Frequency

100 - 104 1

105 - 109 16

110 - 114 71

115 - 119 108

120 - 124 83

125 - 129 18

130 - 134 3

What is the lower class boundary for the first class?

class boundary =

Part 2

In a student survey, fifty-two part-time students were asked how many courses they were taking this term. The (incomplete) results are shown below:

Please round your answer to 4 decimal places for the Relative Frequency if possible.

# of Courses Frequency Relative Frequency Cumulative Frequency

1 23 0.4423 23

2   39

3 13 0.25

What percent of students take exactly two courses? %

A rectangular pyramid is sliced. The slice passes through line segment AB and is parallel to the base.
Which two-dimensional figure represents the cross section?
A. A rectangle the same size as the base
B. A rectangle that is smaller than the base
C. A quadrilateral that is not a rectangle
D. A triangle with a height the same as the pyramid

Answers

Answer:

Step-by-step explanation:

The correct answer is A. A rectangle the same size as the base.

When a rectangular pyramid is sliced parallel to the base, the resulting cross-section is a rectangle that is the same size as the base. The parallel slicing ensures that the cross-section maintains the same dimensions as the base of the pyramid. Therefore, option A, a rectangle the same size as the base, represents the cross-section.

The exponential growth model y = Ae^rt can be used to calculate the future population of a city. In this model, A is the current population, r is the rate of growth, and y is the future population for a specific time, t, in years.

A certain city's population has a growth rate of r = 0.08. Approximately how long will it take the city's population to grow from 250,000 to 675,000?

NEED ASAP

Answers

Step-by-step explanation:

in the formula

y = Ae^rt

y is 675,000

A is 250,000

r is 0.08

to get the value of t

y = Ae^rt

y/A = e^rt

ln(y/A) = rt

[ln(y/A)]/r = t

To determine the time it takes for the city's population to grow from 250,000 to 675,000, we can use the exponential growth model formula:

y = Ae^(rt)

In this case, the initial population (A) is 250,000, and the future population (y) is 675,000. The growth rate (r) is given as 0.08. We need to solve for time (t).

675,000 = 250,000 * e^(0.08t)

To solve for t, we can take the natural logarithm (ln) of both sides:

ln(675,000) = ln(250,000 * e^(0.08t))

ln(675,000) = ln(250,000) + ln(e^(0.08t))

ln(675,000) = ln(250,000) + 0.08t

Now, we can isolate t by subtracting ln(250,000) and dividing by 0.08:

0.08t = ln(675,000) - ln(250,000)

t = (ln(675,000) - ln(250,000)) / 0.08

Calculating this value will give us the approximate time it takes for the population to grow from 250,000 to 675,000.

Function g is a transformation of the parent tangent function such that g(x) = tan(x-4) + 2 . Which graph represents function g?

Answers

Based on the given transformations, the correct graph that represents function g(x) = tan(x-4) + 2 is option c.

How to determine the graph that represents function g(x) = tan(x-4) + 2

To determine the graph that represents function g(x) = tan(x-4) + 2, we can analyze the transformations applied to the parent tangent function.

The parent tangent function has the form f(x) = tan(x). The given function g(x) = tan(x-4) + 2 introduces two transformations:

1. Horizontal shift: The function is shifted 4 units to the right compared to the parent function f(x) = tan(x). This means the graph of g(x) will be shifted to the right by 4 units.

2. Vertical shift: The function is shifted 2 units up compared to the parent function f(x) = tan(x). This means the graph of g(x) will be shifted upward by 2 units.

Based on the given transformations, the correct graph that represents function g(x) = tan(x-4) + 2 is option c. The graph in option c shows a rightward shift of 4 units (horizontal shift) and an upward shift of 2 units (vertical shift), matching the transformations described for g(x).

Learn more about function at  https://brainly.com/question/11624077

#SPJ1

The cost of capsaicin arthritis rub is $21 for a
physical therapist who works with chronic arthritis patients, you need to buy
42 ounces of capsaicin. How many tubes will you need to purchase?

Answers

You will need to purchase approximately 1/42 of a tube, which is less than a full tube. In practical terms, you would need to purchase at least one tube to meet your requirement of 42 ounces of capsaicin arthritis rub.

To determine the number of tubes of capsaicin arthritis rub you will need to purchase, we can divide the total required quantity by the quantity in each tube.

Given that the cost of capsaicin arthritis rub is $21 and you need to buy 42 ounces, we need to find out how many ounces are in each tube.

Let's assume that each tube contains x ounces of capsaicin arthritis rub.

Now we can set up a proportion to solve for x:

42 ounces / x tubes = 1 tube / x ounces

Cross-multiplying gives us:

42x = 1 * x

Simplifying the equation:

42x = x

Dividing both sides of the equation by x (since x cannot be zero):

42 = 1

Since this equation is not true, it means that there is an error in our assumption. We need to revise our assumption.

Let's assume that each tube contains 1 ounce of capsaicin arthritis rub.

Now we can set up a new proportion:

42 ounces / x tubes = 1 tube / 1 ounce

Cross-multiplying gives us:

42x = 1 * 1

Simplifying the equation:

42x = 1

Dividing both sides of the equation by 42:

x = 1/42

As a result, you will need to buy less than a full tube—roughly 1/42 of a tube. In order to get the 42 ounces of capsaicin arthritis rub you need, you would essentially need to buy at least one tube.

for such more question on purchase

https://brainly.com/question/28787564

#SPJ8

Assume a class has 26 members.
a. In how many ways can a president, a vice president, and a secretary be selected?
b. How many committees of 4 people can be chosen?
a. The number of ways to select a president, a vice president, and a secretary is
b. The number of ways to form a 4-person committee is
$0.

Answers

a. There are 15,600 ways to select a president, a vice president, and a secretary from a class of 26 members.

b. There are 14,950 ways to form a 4-person committee from a class of 26 members.

a. To select a president, a vice president, and a secretary from a class of 26 members, we can use the concept of permutations.

For the president position, we have 26 choices. After selecting the president, we have 25 choices remaining for the vice president position. Finally, for the secretary position, we have 24 choices left.

The total number of ways to select a president, a vice president, and a secretary is obtained by multiplying the number of choices for each position:

Number of ways = 26 * 25 * 24 = 15,600

Therefore, there are 15,600 ways to select a president, a vice president, and a secretary from a class of 26 members.

b. To form a 4-person committee from a class of 26 members, we can use the concept of combinations.

The number of ways to choose a committee of 4 people can be calculated using the formula for combinations:

Number of ways = C(n, r) = n! / (r!(n-r)!)

where n is the total number of members (26 in this case) and r is the number of people in the committee (4 in this case).

Plugging in the values, we have:

Number of ways = C(26, 4) = 26! / (4!(26-4)!)

Calculating this expression, we get:

Number of ways = 26! / (4! * 22!)

Using factorials, we simplify further:

Number of ways = (26 * 25 * 24 * 23) / (4 * 3 * 2 * 1) = 14,950

Therefore, there are 14,950 ways to form a 4-person committee from a class of 26 members.

for such more question on committee

https://brainly.com/question/22008756

#SPJ8

elsa hikes up a mountain. she hikes back down at a constant rate the table shows elsas elevation at each hour after she begins her descent

Answers

The linear equation from the given table is expressed as:

y =  -1500x + 8350

How to find the equation from the table?

The general form for the equation of a line in slope intercept form is:

y = mx + c

where:

m is slope

c is y-intercept

The formula for the equation of a line through two coordinates is:

(y - y₁)/(x - x₁) = (y₂ - y₁)/(x₂ - x₁)

We will take the two coordinates (1, 6850) and (2, 5350)

Thus:

(y - 6850)/(x - 1) = (5350 - 6850)/(2 - 1)

(y - 6850)/(x - 1) = -1500

y - 6850 = -1500x + 1500

y = -1500x + 1500 + 6850

y =  -1500x + 8350

Read more about Linear equation at: https://brainly.com/question/16834757

#SPJ1

Here is a unit circle with point P at (1, 0) Find the coordinates of P after the circle rotates the given amount counter clockwise around its center
1. 1/3 of a full rotation: ?
2 1/2 of a full rotation: ?
3. 2/3 of a full rotation: ?

Answers

1/3 of a full rotation: (-0.5, √3/2)

1/2 of a full rotation: (-1, 0)

2/3 of a full rotation: (0.5, -√3/2)

These are the coordinates of point P after the corresponding rotations around the unit circle's center.

To find the coordinates of point P after the unit circle rotates a certain amount counter-clockwise around its center, we can use the properties of the unit circle and the trigonometric functions.

1/3 of a full rotation:

A full rotation in the unit circle corresponds to 360 degrees or 2π radians. Therefore, 1/3 of a full rotation is equal to (1/3) * 360 degrees or (1/3) * 2π radians.

When the unit circle rotates 1/3 of a full rotation, point P will end up at an angle of (1/3) * 2π radians or 120 degrees from the positive x-axis.

In the unit circle, the x-coordinate of a point on the circle represents the cosine of the angle, and the y-coordinate represents the sine of the angle.

At an angle of 120 degrees or (1/3) * 2π radians, the cosine is -0.5 and the sine is √3/2.

Therefore, the coordinates of point P after rotating 1/3 of a full rotation are (-0.5, √3/2).

1/2 of a full rotation:

Similarly, 1/2 of a full rotation is equal to (1/2) * 360 degrees or (1/2) * 2π radians.

When the unit circle rotates 1/2 of a full rotation, point P will end up at an angle of (1/2) * 2π radians or 180 degrees from the positive x-axis.

At an angle of 180 degrees or (1/2) * 2π radians, the cosine is -1 and the sine is 0.

Therefore, the coordinates of point P after rotating 1/2 of a full rotation are (-1, 0).

2/3 of a full rotation:

Again, 2/3 of a full rotation is equal to (2/3) * 360 degrees or (2/3) * 2π radians.

When the unit circle rotates 2/3 of a full rotation, point P will end up at an angle of (2/3) * 2π radians or 240 degrees from the positive x-axis.

At an angle of 240 degrees or (2/3) * 2π radians, the cosine is 0.5 and the sine is -√3/2.

Therefore, the coordinates of point P after rotating 2/3 of a full rotation are (0.5, -√3/2).

for such more question on coordinates

https://brainly.com/question/23907194

#SPJ8

Other Questions
Exercise Add all necessary punctuation marks. Underline words or phrases that should be in italics.What prizewinning author is known for her portrayals of life in the Middle Ages MAAS 213G - Review Do we route emergency calls immediately to the physician? (True or False) When do we offer to call a patient back during a phone call? Which 5 Cs of communication is used when one is being respectful? Define time-specified scheduling What can be a symptom, patients experience when blood sugar fall falling, acting confused, lost Define itinerary What is another term for e-scheduling? low? Franklin made 2 2/5 quarts of hot chocolate. Each mug holds 3/5 of a quart. How many mugs will Franklin be able to fill? prove, using albegra, that the difference between the squares of consecutive even numbers is always a multiple of 4 Consider the following complex number cc. The angles in polar form are in degrees:c=a+ib=2i30+3ei454ei45c=a+ib=2i30+3ei454ei45Determine the real part aa and imaginary part bb of the complex number without using a calculator. (Students should clearly show their solutions step by step, otherwise no credits).Note:cos(90)=cos(90)=sin(0)=0cos(90)=cos(90)=sin(0)=0 ;sin(90)=cos(0)=1sin(90)=cos(0)=1 ;sin(90)=1sin(90)=1;sin(45)=cos(45)=0.707sin(45)=cos(45)=0.707 An ant stands 70 feet away from a tower, and has to look up at a 40 degree angle to see the top. Find the height of the tower. JestionsAll written responses must be handwritten in clear and complete sentences. Using lined paper,please clearly label each response with the appropriate number and letter. (Example: 1) a) ...)1) Points A and B in the diagram show two processestaking place at interactions in Earth's oceanic crust.a) Describe the process taking place at point A.b) Describe the process taking place at point B.continentoceaniccrustBmantlea) Describe how an igneous rock becomes a sedimentary rock.b) Explain why metamorphic rock rarely forms at Earth's surface.Amagma3) Cities A, B, and C are located as shown on the map.A. Explain how the weather at these three locations is likely to differ.B. Explain the cause of the difference in weather between the three locations.B2) The rock cycle is a continuous process by which rocks are formed, changed from one formto another, destroyed, and then reformed again.continentoceaniccrustmantle The psychoanalytic perspective suggests that our early relationships carry forward into our lives by influencing current friendships. Describe the characteristics of people influential in your early childhood, e.g., parents, grandparents, or elementary school teachers. Next, provide descriptions of recent friends. Do you select friends or dating partners based upon similarities with past significant others? Are friendship choices the result of conscious choices or is there some unconscious directive? (4.) Stock Values [LO1] Hedson Corporation will pay a dividend of $3.28 per share next year. The company pledges to increase its dividend by 3.75 percent per year indefinitely. If you require a return of 10 percent on your investment, how much will you pay for the company's stock today? 5. Stock Valuation [LO1] Grateful Eight Co. is expected to maintain a constant 3.7 percent growth rate in its dividends indefinitely. If the company has a dividend yield of 5.6 percent, what is the required return on the company's stock? 6. Stock Valuation [LO1] Suppose you know that a company's stock currently sells for $74 per share and the required return on the stock is 10.6 percent. Ygu, ylyo know that the total return on the stock is evenly divided between a capital Gains yleld and a dividend yield. If it's the company's policy to always maintain a constant growth rate in its dividends, what is the current dividend per share? 7. Stock Valuation [LO1] Burnctt Corp. pays a constant $8,25 dividend on its stock, The company will maintain this dividend for the next 13 years and will then cease paying dividends forever. If the required return on this stock is 11.2 percent, what is the current share price? The annual rate with monthly compounding is 9%. Usingfour digits after the point, calculate the equivalent annual ratewith: A. Quarterly compounding. B. Continuouscompounding. X-treme Vitamin Company is considering two investments, both of which cost $10,000. The cash flows are as follows: a. Which of the two projects should be chosen based on the payback method? b. Which of the two projects should be chosen based on the net present value method? Assume a cost of capital of 10 percent. c. Should a firm normally have more confidence in answer a or answer b ? 14-year-old girl suffering from seasonal rhinitis started a therapy with loratadine, a drug that binds to H1 histamine receptors. Which of the following terms describes a characteristic of loratadine binding to the H1 receptor?a. Potencyb. Affinityc. Maximal efficacyd. Intrinsic activitye. Receptor efficacy someone wants to fly a distance of 100km on a bearing of 100 degrees. speed of plane in still air is 250km/h. a 25km/h wind is vlowing on a bearing of 215 degrees. a villan turns on a magent that exerts a force equivalent to 5km/h on a bearing of 210 degrees on the airplane in the sky. what bearjng will the plane need to take to reach their destination? Exercise 2.2Given CDS spreads with the following tenorsTenor CDS Spread1 1.0%2 1.2%3 1.4%4 1.6%5 1.7%RN Default ProbRisk free rate of 5% flat continuously compounded.What are the risk neutral default probabilities for each year?What is the value of a 5-year CDS with a 200bp spread? dollars per bushel. The workt demand for apples is therefore A. Q=40020P when P is $20 celess. B. Q=200020P when P is $30 or lest. C. Q=400+20P for all ptices.- D. Q=2000=60P when P is $30 or less. Assume you are an intern at a behavioral health clinic that addresses concerns of immigrants and refugees who have crossed borders and cultures to live in the United States. You have been asked to prepare a summary of how you would assist the client in this casewith her depression and anxiety issues.Your supervisor wants you to summarize the situation in this case,since next week she would like you to begin assisting with actual client summaries. You need to demonstrate your knowledge of both anxiety and depression as well as clinical and sociocultural perspectives, which are applicable to all of the clients at the behavioral health clinic.Discuss how the therapist in the case study addressed these sociocultural factors throughout the course of therapy. Question 1Your patient is a young man with Duchenne Muscular Dystrophy who is losing the ability to control his diaphragm What pH imbalance are they experiencing? Why do you say this? How is their body compensating for this imbalance? (Make sure to clearly state the body system involved)How is their body correcting for this imbalance? (Make sure to clearly state the body system involved) 27. If you are going slower than other traffic, do not drive in far.wishes to drive faster, allowing them to pass you. Only move to theA O left, left, right, rightB. O right, right, left, rightC. O right, left, right, rightD. O left, right, left, rightlane. If you are in the....lane, move to the ..... when another driver is close behind you andlane when it is necessary to pass slower vehicles. A cannonball at ground level is aimed 26 degrees above the horizontal and is fired with an initial speed of 105 m/s. How far from the cannon will the cannonball hit the ground? Give your answer in whole numbers. Reduce fraction to lowest term 3+2x-x^2/3+5x+3x^2 Steam Workshop Downloader