Aluminum Chlorohydrate is 10.9 lbs per gallon. It has 12.1-12.7
% aluminum. How many pounds of aluminum are in each gallon?
Assuming 0.87 lbs of Aluminum are needed to inactivate 1 pound
of Phosphorus

Answers

Answer 1

There are approximately 1.1832 pounds of aluminum in each gallon of Aluminum Chlorohydrate.

Given that Aluminum Chlorohydrate is 10.9 lbs per gallon and has 12.1-12.7% aluminum.

We need to determine how many pounds of aluminum are in each gallon.

Solution: The percentage of aluminum in Aluminum Chlorohydrate is 12.1-12.7%

Therefore, the average percentage of aluminum is: 12.1+12.7/2 = 12.4% (taking the mean)

This implies that there is 12.4% aluminum in Aluminum Chlorohydrate

Therefore, the weight of aluminum in 1 gallon of Aluminum Chlorohydrate = 12.4% of 10.9 lbs= (12.4/100) × 10.9= 1.3546 lbs ≈ 1.36 lbs

Now, we know that 0.87 lbs of Aluminum is required to inactivate 1 lb of Phosphorus.

Thus, to inactivate the aluminum present in 1 gallon of Aluminum Chlorohydrate, we need:0.87 × 1.36 = 1.1832 lbs of Aluminum

Know more about here:

https://brainly.com/question/4392857

#SPJ11


Related Questions

Effluent from the aeration stage flown at 200MLD into the coagulation chamber. Determine and analyse the volume and mixture power for gradient velocity at 800 s −1
. Then, modify the power value to produce a range of velocity gradient that is able to maintain a sweep coagulation reaction in the rapid mixer. State the range of power required for this removal mechanism. (Dynamic viscosity, 1.06×10 −3
Pa.s;t=1 s )

Answers

The range of power required to achieve a sweep coagulation reaction in the rapid mixer is 2.46 kW to 4.74 kW.

Dynamic viscosity = 1.06 × 10⁻³

Pa.s and t = 1 s.

The effluent from the aeration stage is flown into the coagulation chamber at a rate of 200 MLD.  

Gradient velocity = 800 s⁻¹.

Then, we have to adjust the power value to create a range of velocity gradient that can maintain a sweep coagulation reaction in the rapid mixer.

Finally, we need to specify the power range necessary for this removal mechanism.

Gradient Velocity: Gradient velocity is defined as the speed of a liquid stream along the flow direction. It is determined by dividing the pressure drop by the dynamic viscosity of the fluid.

In this case, the dynamic viscosity of the fluid is given as 1.06 × 10⁻³ Pa.s.

Gradient velocity is calculated by the formula as follows:

Velocity gradient = ΔP / (η × L)

Where, ΔP = pressure drop

η = dynamic viscosity

L = length of the tube

In this case, the velocity gradient is 800 s⁻¹, and the dynamic viscosity is 1.06 × 10⁻³ Pa.s.Volume and Mixing Power: Volume flow rate (Q) = 200 MLD = 200 × 10⁶/86400 = 2314.81 m³/s

Power (P) = ηQ(ΔH/Δt)

Here, ΔH/Δt is the head loss through the coagulation chamber. As there is no mention of the head loss, we will consider it to be zero. Thus, the power is given as:

P = ηQ × 0P = 1.06 × 10⁻³ × 2314.81P = 2.46 kW

Range of Power Required for Sweep Coagulation Reaction: Sweep coagulation is a process in which coagulants are added to a solution to destabilize the suspended particles.

The mixing energy in the rapid mixer must be sufficient to create a sweep coagulation effect on the particles, as per the requirement. A power range is needed for this removal mechanism.

We can use the following equation to compute the mixing power required to achieve a sweep coagulation reaction:

P = (γ×G×η) / n

Here,G = Velocity gradient

η = dynamic viscosity

γ = 6.5 (Coefficient)

n = 1.5 for impeller operation and 1.2 for jet operation

For the given case,G = 800 s⁻¹η = 1.06 × 10⁻³ Pa.sn = 1.2 for jet operation

Substituting these values in the equation, we get:

P = (6.5 × 800 × 1.06 × 10^−3) / 1.2P = 4.74 kW

Therefore, the range of power required to achieve a sweep coagulation reaction in the rapid mixer is 2.46 kW to 4.74 kW.

Read more on Power here: https://brainly.com/question/11569624

#SPJ11

At atmospheric pressures, water evaporates at 100°C and its latent heat of vaporization is 40,140 kJ/kmol. Atomic weights: C-12; H-1and 0-16. QUESTION 4 (10 marks) A 2 m² oxygen tent initially contains air at 20°C and 1 atm (volume fraction of O, 0.21 and the rest N₂). At a time, t = 0 an enriched air mixture containing 0.35 O₂ (in volume fraction) and the balanse N₂ is fed to the tent at the same temperature and nearly the same pressure at a rate of 1 m³/min, and gas is withdrawn from the tent at 20°C and 1 atm at a molar flow rate equal to that of the feed gas. (a) Write a differential equation for oxygen concentration x(t) in the tent, assuming that the tent contents are perfectly mixed (so that the temperature, pressure, and composition of [5 marks] the contents are the same as those properties of the exit stream). (b) Integrate the equation to obtain an expression for x(t). How long will it take for the mole fraction of oxygen in the tent to reach 0.33?

Answers

A.  The differential equation for oxygen concentration, x(t), in the tent can be written as follows:

dx/dt = (1/V) * (F_in * x_in - F_out * x)

Where:

dx/dt is the rate of change of oxygen concentration with respect to time,

V is the volume of the tent,

F_in is the molar flow rate of the feed gas,

x_in is the mole fraction of oxygen in the feed gas,

F_out is the molar flow rate of the gas withdrawn from the tent,

x is the mole fraction of oxygen in the tent.

B.  Integrating the differential equation, we can obtain an expression for x(t) as follows:

x(t) = (F_in * x_in / F_out) * (1 - e^(-F_out * t / V))

To determine the time it takes for the mole fraction of oxygen in the tent to reach 0.33, we can substitute x(t) = 0.33 into the equation and solve for t.

a. The differential equation for the oxygen concentration in the tent is derived based on the assumption of perfect mixing, where the contents of the tent have the same properties as the exit stream. The equation considers the inflow and outflow of gas and their respective oxygen concentrations.

b. Integrating the differential equation provides an expression for the oxygen concentration in the tent as a function of time. The equation considers the inflow and outflow rates, as well as the initial oxygen concentration in the feed gas. The term (1 - e^(-F_out * t / V)) represents the fraction of oxygen that accumulates in the tent over time.

To determine the time it takes for the mole fraction of oxygen to reach 0.33, we substitute x(t) = 0.33 into the equation and solve for t.

The differential equation and its integration provide a mathematical description of the change in oxygen concentration over time in the oxygen tent. By solving the equation for a specific mole fraction, such as 0.33, the time required for the oxygen concentration to reach that value can be determined. These calculations are based on the given conditions and assumptions, and they allow for the understanding and prediction of oxygen concentration dynamics in the tent.

To know more about concentration visit ,

https://brainly.com/question/28564792

#SPJ11

c) Analyse the considerations involved in designing safety relief system and relief scenario for a chlorination reactor with organic reactants.

Answers

The safety relief system is an important component of a process plant. A good safety relief system ensures that the equipment is protected against overpressure situations. Chlorination reactors with organic reactants require the utmost care in the design of the relief systems.

Considerations involved in designing safety relief system and relief scenario for a chlorination reactor with organic reactants are discussed below:

1. Hazard Identification: Identify the hazards associated with the reaction chemistry of the chlorination reactor with organic reactants. Also, assess the potential failure scenarios that may lead to an overpressure event.

2. Relief Scenarios: Consider the design of relief scenarios that will be used to protect the reactor and the surrounding equipment. The scenarios should be designed to address all potential overpressure events.

3. Relief Devices: Choose the right type of relief device(s) based on the process parameters and the required relief scenario. The relief devices must be designed to relieve the pressure within the reactor in a safe manner.

4. Relief Sizing: Calculate the size of the relief devices based on the maximum potential relief flow rate. The sizing should be done in such a way that the device can handle the maximum expected pressure with a reasonable margin of safety.

5. Relief Piping: Design the relief piping such that it has the capacity to handle the maximum expected relief flow rate. The piping should be arranged in such a way that it can relieve the pressure in a safe manner.

6. Relief Header and Disposal: Design the relief header and the disposal system in such a way that it can safely handle the maximum expected relief flow rate. The header and the disposal system should be arranged in such a way that they do not pose a hazard to the surrounding equipment and personnel.

7. Testing and Maintenance: Test the relief system regularly to ensure that it functions as expected. Also, maintain the system in accordance with the manufacturer's recommendations to ensure that it remains in good working order.

to know about  safety relief system

https://brainly.com/question/31387275

#SPJ11

The saturated solution containing 1500 kg of KCl at
360°K is cooled in a
open tank at 290°K. If the relative density of the solution is 1.2
and the solubility of potassium chloride is 53.35 per 100

Answers

The mass of KCl that crystallizes out is approximately 1280.36 kg.

Given parameters:

Initial temperature T1 = 360 K

Final temperature T2 = 290 K

Weight of KCl = 1500 kg

Relative density of the solution = 1.2

Solubility of KCl = 53.35 g/100 g of water (at 290 K)

We need to calculate the mass of KCl that crystallizes out after cooling down the saturated solution.

Let's find the concentration of the solution at T1:

Concentration = Mass of solute / Mass of solvent+ solute

Concentration = 1500 kg / (1.2 * 1000 kg) = 1.25 kg/kg of solution (or) 1250 g/kg of solution

We know that the solubility of KCl at 290 K is 53.35 g/100 g of water.

So, the solubility of KCl in 1000 g (1 kg) of water is 533.5 g/ kg of water.

Therefore, the solubility of KCl in 1250 g of water (which is present in 1 kg of solution) is (533.5 / 1000) * 1250 g/kg of water = 667.1875 g/kg of water.

The concentration of the saturated solution at T1 is 1250 + 667.1875 = 1917.1875 g/kg of solution. This is the maximum concentration of KCl that can be present in the solution at 360 K.

At T2 (290 K), the solubility of KCl is 53.35 g/100 g of water. So, the concentration of the solution at T2 is (53.35 / 100) * 1000 g/kg of water = 533.5 g/kg of water.

In order for KCl to crystallize out of the solution, its concentration has to exceed the maximum solubility of KCl at 290 K, which is 533.5 g/kg of water.

Therefore, the mass of KCl that crystallizes out is:

Mass of KCl = (Concentration at T1 - Concentration at T2) * Weight of solvent

Mass of KCl = (1917.1875 - 533.5) * 1.2 * 1000 kg = 1280362.5 g = 1280.3625 kg

Know more about mass here:

https://brainly.com/question/32091099

#SPJ11

please show all steps and dont copy-paste from another chegg
solution
Calculate the vapour pressure (in mm Hg) of water at 20 °C using the data below: The heat of vaporisation: 40.66 kJ/mol Boiling point: 100 °C (at 1.0 atm) According to the result, what can be said a

Answers

Answer : vapour pressure : 1251.5 mmHg

To calculate the Vapour pressure of water at 20 °C, we will use the Antoine Equation, which is as follows:

log P = A − (B / (T + C)), where P is the pressure (in mmHg) and T is the temperature (in Celsius).

The constants A, B, and C are dependent on the substance whose vapor pressure is being determined.

For water, they are as follows:

A = 8.07131

B = 1730.63

C = 233.426

First, let's convert the temperature from Celsius to Kelvin: T = 20 + 273 = 293 K

Now, we can plug in the values into the Antoine Equation :log P = 8.07131 - (1730.63 / (233.426 + 293))

log P = 4.88208P = antilog(4.88208)

P = 1251.5 mmHg

Therefore, the Vapour pressure of water at 20 °C is 1251.5 mmHg.

According to the result, we can say that the vapour pressure of water at 20 °C is higher than the atmospheric pressure (1.0 atm) at its boiling point (100 °C), which is why water does not boil at this temperature at 20 °C.

Know more about Vapour pressure here:

https://brainly.com/question/13256548

#SPJ11

9. The relationship between overshoot and decay ratio is O (i) Overshoot = Decay ratio (ii) Decay ratio= (Overshoot)2 O Overshoot = 2 Decay ratio O None of these 1 point

Answers

The relationship between overshoot and decay ratio is as follows :None of these

Overshoot and decay ratio are two important concepts used in control system engineering.

The overshoot is the maximum amount of an output signal or variable that exceeds the steady-state value or the desired output value.

The decay ratio is defined as the rate at which the amplitude of an output signal or variable decreases after reaching the maximum value and returning to the steady-state value.

It is critical to note that the overshoot and decay ratio are inversely proportional to one another. Therefore, as the overshoot value increases, the decay ratio value decreases, and vice versa. This statement contradicts all of the provided options.

Hence, the correct answer is "None of these."

Know more about decay here:

https://brainly.com/question/12573886

#SPJ11

Calculate the equilibrium constant k for the reaction: 2 Hg (1) + O₂(g) 28 °C. AG=-11.8 KJ/mol and R = 8.314 J/mol K 2 HgO 9s) at 1. Predict the sign of the entropy change for the following reactions a. RaCO3 (s) ‒‒‒‒‒‒‒‒‒ RaO (s) + COz (g) b. SnS₂ (1) c. 2 Pd (1) + O₂ (g) - ---- 2 PdO (s) d. 2 Rb₂O₂ (s) + 2 H₂O (1) -------- 4 RbOH (aq) + O₂ (g) 1. A) - B) - C) + D) + 2. A) + B) + C) - D) + 3. A) + B) - C) + D) - 4. A) - B) + C) - D) + SnS (g)

Answers

1. The equilibrium constant (K) for the reaction is approximately 1.004739.

2. Predictions for the signs of the entropy changes:

  a) C) +

  b) A) +

  c) B) -

  d) D) +

1. To calculate the equilibrium constant (K) for the given reaction, we can use the relationship between ΔG° (standard Gibbs free energy change) and K:

ΔG° = -RT ln(K)

ΔG° = -11.8 kJ/mol

R = 8.314 J/mol K

Temperature (T) = 28°C = 301 K (convert to Kelvin)

Plugging these values into the equation, we can solve for K:

-11.8 kJ/mol = -8.314 J/mol K * 301 K * ln(K)

Simplifying the equation:

-11.8 = -2497.914 J/mol * ln(K)

ln(K) = -11.8 / -2497.914

ln(K) = 0.004727

Now we can calculate K by taking the exponential of both sides:

K = e^(0.004727)

K ≈ 1.004739

Therefore, the equilibrium constant (K) for the given reaction at 28°C is approximately 1.004739.

Now, let's predict the sign of the entropy change for the given reactions:

a. RaCO₃ (s) → RaO (s) + CO₂ (g)

Since solid reactants are being converted into both a solid product and a gas product, the entropy change is likely positive. The correct answer is: C) +

b. SnS₂ (s) → SnS (g)

The reaction involves a solid reactant converting into a gaseous product. This suggests an increase in entropy. The correct answer is: A) +

c. 2 Pd (s) + O₂ (g) → 2 PdO (s)

The reaction involves a gas reacting with a solid to form a solid product. The entropy change is likely negative. The correct answer is: B) -

d. 2 Rb₂O₂ (s) + 2 H₂O (l) → 4 RbOH (aq) + O₂ (g)

The reaction involves the formation of aqueous solutions and a gaseous product. The entropy change is likely positive. The correct answer is: D) +

Learn more about equilibrium constants at https://brainly.com/question/3159758

#SPJ11

8. [10 points] Nitrogen is compressed isentropically from 100 kPa and 27 °C to 1000 kPa in a piston cylinder device. Assume ideal gas and determine its final temperature. Given C₂= 1.042 and C=0.745

Answers

The final temperature of nitrogen, when compressed isentropically from 100 kPa and 27 °C to 1000 kPa, is approximately 132.15 K.

To determine the final temperature of nitrogen when compressed isentropically from 100 kPa and 27 °C to 1000 kPa, we can use the ideal gas equation and the isentropic process relationship.

The ideal gas equation is given as:

PV = mRT,

where P is the pressure, V is the volume, m is the mass, R is the specific gas constant, and T is the temperature.

For an isentropic process, we have the relationship:

P₁V₁^γ = P₂V₂^γ,

P₁ = 100 kPa

P₂ = 1000 kPa

T₁ = 27 °C

= 27 + 273.15

= 300.15 K

C₂ = 1.042

C = 0.745

We need to calculate T₂, the final temperature.

First, let's find the initial volume, V₁, using the ideal gas equation:

V₁ = (mRT₁) / P₁.

Next, let's rearrange the isentropic process relationship to solve for the final volume, V₂:

V₂ = V₁ * (P₁ / P₂)^(1/γ).

We can now enter the provided values into the equations and find the final temperature by solving.

Rearranging the ideal gas equation:

V₁ = (mRT₁) / P₁

V₁ = (m * R * 300.15 K) / (100 kPa)

V₁ = (m * R * 300.15) / (100000 Pa)

Rearranging the isentropic process relationship:

V₂ = V₁ * (P₁ / P₂)^(1/γ)

V₂ = [(m * R * 300.15) / (100000 Pa)] * [(100 kPa) / (1000 kPa)]^(1/γ)

V₂ = [(m * R * 300.15) / (100000 Pa)] * (0.1)^(1/γ)

Now, let's use the ideal gas equation again to find the final temperature, T₂:

P₂ * V₂ = m * R * T₂

(1000 kPa) * [(m * R * 300.15) / (100000 Pa)] * (0.1)^(1/γ) = m * R * T₂

(1000) * (m * R * 300.15) * (0.1)^(1/γ) = m * R * T₂

Canceling out the mass and R:

1000 * 300.15 * (0.1)^(1/γ) = T₂

Substituting the given value for γ:

1000 * 300.15 * (0.1)^(1/1.042) = T₂

Calculating the final temperature, T₂:

T₂ ≈ 132.15 K

The final temperature of nitrogen, when compressed isentropically from 100 kPa and 27 °C to 1000 kPa, is approximately 132.15 K.

To know more about Temperature, visit

brainly.com/question/4735135

#SPJ11

A 2 m³ oxygen tent initially contains air at 20°C and 1 atm (volume fraction of O₂ 0.21 and the rest N₂). At a time, t = 0 an enriched air mixture containing 0.35 O₂ (in volume fraction) and the balance N₂ is fed to the tent at the same temperature and nearly the same pressure at a rate of 1 m³/min, and gas is withdrawn from the tent at 20°C and 1 atm at a molar flow rate equal to that of the feed gas. (a) Write a differential equation for oxygen concentration x(t) in the tent, assuming that the tent contents are perfectly mixed (so that the temperature, pressure, and composition of the contents are the same as those properties of the exit stream). [5 marks] (b) Integrate the equation to obtain an expression for x(t). How long will it take for the mole fraction of oxygen in the tent to reach 0.33?

Answers

(A) The differential equation for oxygen concentration, x(t), in the tent is given by:

dx/dt = (F_in * x_in - F * x) / V

where:

dx/dt is the rate of change of oxygen concentration with respect to time,

F_in is the feed gas flow rate,

x_in is the oxygen concentration in the feed gas,

F is the gas withdrawal flow rate,

x is the current oxygen concentration in the tent, and

V is the volume of the tent.

(B) To integrate the equation, we need additional information such as the initial oxygen concentration in the tent. Once we have this information, we can use the initial condition and the differential equation to solve for x(t) as a function of time. The time it takes for the mole fraction of oxygen in the tent to reach 0.33 can be determined by substituting this value into the expression for x(t) and solving for time.

(a) The differential equation for oxygen concentration, x(t), can be derived by applying the principle of conservation of mass to the oxygen in the tent. The rate of change of oxygen concentration is equal to the rate of oxygen entering the tent minus the rate of oxygen being withdrawn, divided by the volume of the tent.

dx/dt = (F_in * x_in - F * x) / V

(b) To integrate the differential equation, we need an initial condition. Let's assume the initial oxygen concentration in the tent is x(0) = x_0. Integrating the differential equation with this initial condition yields:

∫ dx / (F_in * x_in - F * x) = ∫ dt / V

Integrating both sides of the equation will give us an expression for x(t). However, the specific integration limits and the integration process depend on the initial and boundary conditions.

To determine the time it takes for the mole fraction of oxygen in the tent to reach 0.33, we can substitute x(t) = 0.33 into the expression for x(t) and solve for time.

The differential equation dx/dt = (F_in * x_in - F * x) / V represents the rate of change of oxygen concentration in the tent. By integrating this equation with suitable initial and boundary conditions, we can obtain an expression for x(t) as a function of time. The time it takes for the mole fraction of oxygen to reach a specific value can be determined by substituting that value into the expression for x(t) and solving for time.

To know more about concentration visit,

https://brainly.com/question/28564792

#SPJ11

3.4 Show ALL steps on how you can prepare 2-methylhexan-3-ol from propan-2-ol. (4)

Answers

To prepare 2-methylhexan-3-ol from propan-2-ol, you can follow the following steps:

Step 1: Oxidation of propan-2-ol to propanone (acetone) using an oxidizing agent such as potassium dichromate (K2Cr2O7) and sulfuric acid (H2SO4). This reaction converts propan-2-ol into propanone.

Step 2: Condensation of propanone with formaldehyde (HCHO) in the presence of an acid catalyst, such as sulfuric acid (H2SO4), to form a hemiacetal intermediate.

Step 3: Reduction of the hemiacetal intermediate using a reducing agent, such as sodium borohydride (NaBH4), to yield the desired 2-methylhexan-3-ol.

Step 1: Oxidation of propan-2-ol to propanone (acetone)

Propan-2-ol (CH3CH(OH)CH3) can be oxidized to propanone (CH3COCH3) using an oxidizing agent like potassium dichromate (K2Cr2O7) and sulfuric acid (H2SO4).

The reaction is typically carried out under reflux conditions.

The balanced chemical equation for this reaction is:

CH3CH(OH)CH3 + [O] -> CH3COCH3 + H2O

Step 2: Rearrangement of propanone to 2-methylhexan-3-one

Propanone (CH3COCH3) can undergo a rearrangement reaction known as the haloform reaction in the presence of a halogen, such as chlorine (Cl2), and a base, like sodium hydroxide (NaOH).

The reaction proceeds through the formation of an enolate intermediate.

The balanced chemical equation for this reaction is:

CH3COCH3 + 3Cl2 + 4NaOH -> CH3C(O)CHCl2 + 3NaCl + 3H2O

Step 3: Reduction of 2-methylhexan-3-one to 2-methylhexan-3-ol

2-Methylhexan-3-one (CH3C(O)CHCl2) can be reduced to 2-methylhexan-3-ol (CH3CH2CH(CH3)CH(CH3)CH2OH) using a reducing agent like lithium aluminum hydride (LiAlH4) in an appropriate solvent such as diethyl ether (Et2O).

The balanced chemical equation for this reaction is:

CH3C(O)CHCl2 + 4LiAlH4 -> CH3CH2CH(CH3)CH(CH3)CH2OH + 4LiCl + 4Al(OH)3

By following these steps, you can convert propan-2-ol into 2-methylhexan-3-ol. The oxidation of propan-2-ol produces propanone, which is then condensed with formaldehyde to form a hemiacetal intermediate. Finally, the reduction of the hemiacetal intermediate yields the desired product, 2-methylhexan-3-ol. It is important to note that the reaction conditions and specific reagents may vary depending on the experimental setup and desired yield.

To know more about propan-2-ol, visit

https://brainly.in/question/1168927

#SPJ11

Which statement describes the potential energy diagram of an eco therm if reaction? A the activation energy of the reactants is greater than the activation energy of the products

Answers

The true statement is that the potential energy of the reactants is greater than the potential energy of the products.

What is an exothermic reaction?

A chemical process known as an exothermic reaction produces heat as a byproduct. An exothermic reaction produces a net release of energy because the reactants have more energy than the products do. Although it can also be released as light or sound, this energy usually manifests as heat.

The overall enthalpy change (H) in an exothermic reaction is negative, indicating that heat is released during the reaction. Usually, the energy released is passed to the environment, raising the temperature.

Learn more about exothermic reaction:https://brainly.com/question/18523044

#SPJ1

Penicillium chrysogenum is used to produce penicillin in a 50,000-litre fermenter. The volumetric rate of oxygen uptake by the cells ranges from 0.45 to 0.85 mmol L-1 min-1 depending on time during the culture. Power input by stirring is 2.9 Watts/L. Estimate the cooling requirements.
Please use energy balance

Answers

To estimate the cooling requirements for the fermentation process, we can use an energy balance equation.

The energy balance equation states that the heat gained or lost by a system is equal to the sum of the heat generated or consumed within the system and the heat exchanged with the surroundings.

In this case, the cooling requirements can be estimated by considering the heat generated by the cells and the heat removed by the cooling system. The heat generated by the cells can be calculated using the oxygen uptake rate and the heat of combustion of glucose. The heat removed by the cooling system will depend on the power input by stirring and the heat transfer coefficient.

Here are the steps to estimate the cooling requirements:

1. Calculate the heat generated by the cells:

  - Determine the average oxygen uptake rate (mmol L^(-1) min^(-1)) by taking the average of the given range (0.45 to 0.85 mmol L^(-1) min^(-1)).

  - Convert the oxygen uptake rate to moles per second (mol s^(-1)).

  - Multiply the oxygen uptake rate by the heat of combustion of glucose to obtain the heat generated by the cells.

2. Calculate the heat removed by the cooling system:

  - Convert the power input by stirring to joules per second (W).

  - Calculate the heat transfer rate using the heat transfer coefficient. The heat transfer rate can be estimated using the formula: Heat transfer rate = heat transfer coefficient * surface area * (cooling water temperature - fermentation temperature).

3. Determine the cooling requirements:

  - The cooling requirements will be the sum of the heat generated by the cells and the heat removed by the cooling system.

Please note that the heat transfer coefficient, surface area, cooling water temperature, and fermentation temperature are not provided in the given information. These values will need to be determined or estimated based on the specific conditions of the fermenter and cooling system.

To know more about Penicillium related question visit:

https://brainly.com/question/31833853

#SPJ11

EXAMPLE 24.1. A filter cake 24 in. (610 mm) square and 2 in. (51 mm) thick, sup- ported on a screen, is dried from both sides with air at a wet-bulb temperature of 80°F (26.7°C) and a dry-bulb tempe

Answers

To calculate the time required to dry the filter cake, we need additional information such as the airflow rate, humidity, and drying characteristics of the filter cake. Without these details, it is not possible to provide a specific calculation for the drying time. The drying time can be determined using appropriate drying rate equations or empirical correlations specific to the material and drying conditions.

To determine the drying time for the filter cake, we need to consider factors such as the airflow rate, humidity, and drying characteristics of the filter cake. These factors will influence the evaporation rate and thus the drying time.

Additionally, the specific drying characteristics of the filter cake, such as its porosity and moisture content, will play a significant role in determining the drying time.To calculate the drying time, we typically use drying rate equations or empirical correlations specific to the particular material and drying conditions.

To accurately calculate the drying time for the filter cake, additional information such as the airflow rate, humidity, and drying characteristics of the filter cake is necessary. The drying time can be determined using appropriate drying rate equations or empirical correlations specific to the material and drying conditions. It's important to consider the unique properties of the filter cake and the specific drying process to obtain accurate results. Without this information, it is not possible to provide a specific calculation or draw a conclusion regarding the drying time of the filter cake in this particular example.

To know more about humidity visit:

https://brainly.com/question/28931915

#SPJ11

When ionic bonds form, the resulting compounds are A. electrically neutral B. electrically unstable C. negatively charged D. positively charged

Answers

When ionic bonds form, the resulting compounds are option A) electrically neutral.

Ionic bonds are formed between atoms that have significantly different electronegativities. In this type of bond, one atom donates electrons to another atom, resulting in the formation of positive and negative ions. The positively charged ion is called a cation, while the negatively charged ion is called an anion.

The key characteristic of ionic compounds is that they are electrically neutral. This means that the overall charge of the compound is zero. The positive charges of the cations are balanced by the negative charges of the anions, resulting in a neutral compound.

For example, in the formation of sodium chloride (NaCl), sodium (Na) donates one electron to chlorine (Cl). This results in the formation of a sodium cation (Na+) and a chloride anion (Cl-). The positive charge of the sodium ion is balanced by the negative charge of the chloride ion, making the compound electrically neutral.

In summary, when ionic bonds form, the resulting compounds are electrically neutral because the positive and negative charges of the ions balance each other out, creating a net charge of zero.

To know more about ionic bonds click here:

https://brainly.com/question/9075398

#SPJ11

Water 3.0 deals mainly with sewage treatment.
Describe which chemicals are currently not broken down by currently
used wastewater technologies and why that is important.

Answers

Water 3.0 deals mainly with sewage treatment. The primary aim of this project is to reduce the harmful impacts of chemical pollutants from industrial and agricultural activities on natural water resources.

Currently, used wastewater treatment technologies can break down some of the chemicals in wastewater but not all of them. Chemicals that are not broken down are referred to as persistent organic pollutants. These chemicals persist in the environment for long periods, and they can cause severe damage to aquatic life and human health.
Currently, the primary challenge facing water treatment technologies is the removal of persistent organic pollutants such as pesticides, pharmaceuticals, and endocrine-disrupting chemicals from wastewater.

These pollutants are generally water-soluble and resist microbial degradation, making them hard to remove from wastewater using current water treatment technologies. For example, conventional activated sludge treatment used in wastewater treatment plants does not remove some persistent organic pollutants from wastewater.
Failure to remove these pollutants from wastewater can have significant environmental and health impacts.

For example, pharmaceutical chemicals can cause antibiotic resistance, while endocrine-disrupting chemicals can cause birth defects, cancer, and other health problems.

Therefore, there is a need to improve wastewater treatment technologies to remove persistent organic pollutants from wastewater.
In conclusion, wastewater treatment technologies can break down some chemicals but not all. Chemicals that are not broken down are persistent organic pollutants and pose a significant risk to the environment and human health. Therefore, it is important to develop wastewater treatment technologies that can remove these pollutants from wastewater.

To know more about chemicals visit:

https://brainly.com/question/29240183

#SPJ11

Please explain the levels of maintenance in regards to a
beer brewery.
•Level 1 - Organizational: At the operational site (low
maintenance skills)
•Level 2 - Intermediate: Mobile or Fixed units /

Answers

In a beer brewery, the levels of maintenance refer to the different stages or categories of maintenance activities that are performed to ensure the smooth operation and reliability of the brewing equipment and facilities. These levels can vary depending on the complexity of the maintenance tasks and the skills required to perform them. Here are the explanations for two levels of maintenance commonly seen in beer breweries:

1. Level 1 - Organizational Maintenance:

At this level, the maintenance activities primarily focus on the day-to-day operations and basic upkeep of the brewing equipment. These tasks are often carried out by the operational staff at the brewery site who have basic maintenance skills. The activities involved at this level may include routine inspections, cleaning, lubrication, and minor repairs or adjustments. The goal is to maintain the equipment in good working condition, prevent breakdowns, and ensure the production process runs smoothly.

2. Level 2 - Intermediate Maintenance:

The intermediate maintenance level involves more specialized tasks that may require the involvement of dedicated maintenance personnel or specialized technicians. This level includes maintenance activities performed on mobile or fixed units within the brewery, such as specific brewing vessels, fermentation tanks, or packaging equipment. These tasks often require a higher level of technical expertise and knowledge of the brewing process. Examples of activities at this level can include equipment calibration, troubleshooting and diagnostics, preventive maintenance, component replacement, and equipment optimization.

It's important to note that the levels of maintenance may vary depending on the size of the brewery, the complexity of the brewing process, and the level of automation in place. Larger breweries with more advanced equipment and automation systems may have additional levels of maintenance, such as advanced diagnostics and predictive maintenance, to ensure maximum efficiency and minimize downtime.

In summary, the levels of maintenance in a beer brewery range from basic organizational maintenance performed by operational staff to intermediate maintenance carried out by dedicated maintenance personnel or specialized technicians. These levels reflect the varying complexity and skill requirements of the maintenance tasks involved in ensuring the smooth operation of the brewery's equipment and facilities.

To know more about reliability visit:

https://brainly.com/question/2976377

#SPJ11

It
is desired to react 10% of substance A and substance B in a stirred
tank at 65 °C and pH: 3.5 conditions. In this system where
continuous feeding is made, the product formed is taken from the
syst

Answers

In the given conditions, the desired reaction is to react 10% of substance A and substance B in a stirred tank at 65 °C and pH 3.5. The product formed is continuously removed from the system.

To determine the reaction conditions, we need to consider the reaction kinetics and the reaction rate. The reaction rate is usually dependent on factors such as temperature, pH, and reactant concentrations. However, without specific information about the reaction kinetics and the specific substances involved, it is difficult to provide precise calculations.

However, to achieve the desired conversion of 10%, you may need to adjust parameters such as residence time, feed rates, and reactant concentrations. This can be done through process optimization and experimentation. By varying these parameters and monitoring the reaction progress, you can find the optimal conditions that yield the desired conversion.

To react 10% of substance A and substance B in a stirred tank, continuous feeding and product removal are necessary. However, without detailed information about the reaction kinetics and specific substances involved, it is challenging to provide precise calculations for the required feed rates, residence time, and other parameters. Process optimization and experimentation would be required to determine the optimal conditions to achieve the desired conversion.

The given question in complete form is, It is desired to react 10% of substance A and substance B in a stirred tank at 65 °C and pH: 3.5 conditions. In this system where continuous feeding is made, the product formed is taken from the system intermittently. This process is achieved by drawing 10% of the reactor content according to the residence time in the reactor using vacuum. Accordingly, draw the shape of the system you propose so that the product (C) can be produced under the desired conditions and show the necessary control units and elements on the figure in question.

To know more about reaction , visit

https://brainly.com/question/25769000

#SPJ11

Answer with true (T) or False (F): a) The key heavy compound is the heaviest compound exists at the bottom of distillation tower........ ..............( ) b) The top reflux in a distillation column allows to heat the distillated.(). c) The Scheibel and Jenny diagram is used for calculate the efficiency in a absorption tower........ ..............() d) O'Connor diagram allows to calculate the efficiency in the distillation column in the Mc Thiele method. ............ e) Mc Cabe Thiele method is used for determine the number of trays of a distillation columns for binary mixtures.

Answers

a) False (F) - The key heavy compound is the heaviest compound that preferentially concentrates at the top of the distillation tower, not at the bottom.

b) False (F) - The top reflux in a distillation column allows for cooling and condensing the vapors, not heating the distillate.

c) False (F) - The Scheibel and Jenny diagram is not used for calculating the efficiency in an absorption tower. It is used for analyzing the efficiency of a distillation column.

d) False (F) - The O'Connor diagram is not used to calculate the efficiency in a distillation column. It is used to determine the number of theoretical stages required for a given separation.

e) True (T) - The McCabe Thiele method is indeed used to determine the number of trays (theoretical stages) required for achieving a desired separation in a distillation column for binary mixtures.

Statements (a), (b), (c), and (d) are false, while statement (e) is true.

To know more about compound, visit

https://brainly.com/question/29108029

#SPJ11

Write the reduction and oxidation half reactions MnO4-(aq)+Cl-(aq)—>Mn2+ +Cl2(g)

Answers

The half-reaction is  

Reduction: [tex]2MnO_4^-(aq) + 16H^+(aq) + 10e^- \rightarrow 2Mn_2^+(aq) + 8H_2O(l).[/tex]

Oxidation: [tex]2Cl^-(aq) \rightarrow Cl_2(g) + 2e^-.[/tex]

To determine the reduction and oxidation half-reactions for the reaction:

[tex]MnO_4^-(aq) + Cl^-(aq) \rightarrow Mn_2^+(aq) + Cl_2(g)[/tex]

Let's break down the reaction into the reduction and oxidation half-reactions:

Reduction Half-Reaction:

[tex]MnO_4^-(aq) + 8H^+(aq) + 5e^- \roghtarrow Mn_2^+(aq) + 4H_2O(l)[/tex]

In the reduction half-reaction, [tex]MnO_4^-[/tex](aq) gains 5 electrons (5e-) and is reduced to [tex]Mn_2^+[/tex](aq). Hydrogen ions ([tex]H^+[/tex]) from the acid solution are also involved in balancing the charges, resulting in the formation of water [tex](H_2O)[/tex].

Oxidation Half-Reaction:

[tex]2Cl^-(aq) \rightarrow Cl_2(g) + 2e^-[/tex]

In the oxidation half-reaction, 2 chloride ions ([tex]Cl^-[/tex]) lose 2 electrons (2e-) and are oxidized to form chlorine gas ([tex]Cl_2[/tex]).

Balancing the number of electrons in both half-reactions:

Multiply the reduction half-reaction by 2:

[tex]2MnO_4^-(aq) + 16H^+(aq) + 10e^- \rightarrow 2Mn_2^+(aq) + 8H_2O(l)[/tex]

Now, the number of electrons lost in the oxidation half-reaction (2e-) matches the number gained in the reduction half-reaction (10e-).

Overall balanced equation:

[tex]2MnO_4^-(aq) + 16H^+(aq) + 10Cl^-(aq) \rightarrow 2Mn_2^+(aq) + 8H_2O(l) + 5Cl_2(g)[/tex]

Therefore, the reduction half-reaction is [tex]2MnO_4^-(aq) + 16H^+(aq) + 10e^- \rightarrow 2Mn_2^+(aq) + 8H_2O(l)[/tex], and the oxidation half-reaction is [tex]2Cl^-(aq) \rightarrow Cl_2(g) + 2e^-.[/tex]

For more questions on Oxidation, click on:

https://brainly.com/question/10211542

#SPJ8

What technique can we use to distingue light elements and heavy
elements?

Answers

Mass spectrometry is a technique commonly used to distinguish light elements from heavy elements.

One technique commonly used to distinguish light elements from heavy elements is Mass Spectrometry. Mass spectrometry is a powerful analytical technique that measures the mass-to-charge ratio of ions. By subjecting a sample to ionization and then separating the ions based on their mass-to-charge ratio, mass spectrometry can provide information about the elemental composition of a sample.

In mass spectrometry, ions are accelerated through an electric field and then deflected by a magnetic field, causing them to follow different paths based on their mass-to-charge ratio. By detecting the ions at different positions or using a mass analyzer, the relative abundance of different isotopes or elements can be determined.

Since different elements have different masses, mass spectrometry can effectively distinguish light elements (e.g., hydrogen, carbon, nitrogen) from heavy elements (e.g., lead, uranium). This technique is widely used in various fields such as chemistry, geology, forensics, and environmental analysis for elemental identification and isotopic analysis.

Read more on Mass spectrometry here: https://brainly.com/question/28174174

#SPJ11

Biogeochemical cycles: Which one of the following statements is true?
Plants need carbon dioxide to survive. They do not need oxygen.
The percentages of water in body mass for different plants and animals are mostly the same.
The source of energy for all life on Earth is the geothermal energy.
Most of Earth’s carbon is stored in vegetation/forests.
Most plants cannot use nitrogen directly from the atmosphere.

Answers

Answer:

Most plants cannot use nitrogen directly from the atmosphere.

Explanation:

It is desired to obtain an acid with optimum
conditions for the purification of minerals. What amount of water
is necessary to evaporate 1 m3 of H2SO4 (d = 1560 kg/m3) 62% by
mass to obtain acid with

Answers

To obtain acid with a specific concentration by evaporating a 62% mass fraction of H2SO4 solution, the amount of water needed to evaporate from 1 m3 of the solution is determined. The density of H2SO4 is given as 1560 kg/m3.

To calculate the amount of water required to evaporate from 1 m3 of the H2SO4 solution, we first need to determine the mass of the solution. Since the mass fraction of H2SO4 is given as 62%, it means that 62% of the mass of the solution is sulfuric acid, and the remaining 38% is water.

Given that the density of H2SO4 is 1560 kg/m3, we can calculate the mass of H2SO4 in the solution by multiplying the volume (1 m3) by the density (1560 kg/m3) and the mass fraction (0.62):

Mass of H2SO4 = 1 m3 * 1560 kg/m3 * 0.62 = 967.2 kg

Since the total mass of the solution is the sum of the masses of H2SO4 and water, we can calculate the mass of water:

Mass of water = Total mass of solution - Mass of H2SO4

Mass of water = 1 m3 * 1560 kg/m3 - 967.2 kg = 592.8 kg

Therefore, to obtain acid with the desired concentration, approximately 592.8 kg of water needs to be evaporated from 1 m3 of the H2SO4 solution. It's important to note that the calculation assumes that the volume remains constant during the evaporation process. In practical scenarios, there may be some volume changes due to temperature and pressure variations. Additionally, factors such as heat transfer, vaporization efficiency, and equipment design should be considered for precise control of the evaporation process.

Learn more about mass fraction here:- brainly.com/question/32271702

#SPJ11

Consider the chemical reaction: 2C₂H₂ + O₂ → 2C₂H4O 100 kmol of C₂H4 and 100 kmol of O2 are fed to the reactor. How many moles of O₂ and C₂H4O are in the product and what is the extent of the reaction? 50 kmol, 50 kmol, 50 kmol 50 kmol, 100 kmol, 50 kmol 50 kmol, 100 kmol, 100 kmol O 100 kmol, 50 kmol, 50 kmol

Answers

the product will contain 50 kmol of O₂ and 100 kmol of C₂H₄O. The correct answer is: 50 kmol, 100 kmol, 100 kmol O₂.

The balanced chemical equation for the reaction is:

2C₂H₂ + O₂ → 2C₂H₄O

According to the stoichiometry of the reaction, 2 moles of C₂H₂ react with 1 mole of O₂ to produce 2 moles of C₂H₄O.

Given:

- 100 kmol of C₂H₄

- 100 kmol of O₂

Since the stoichiometry of the reaction is 2:1 for C₂H₂ to O₂, the limiting reactant will be the one that is present in lesser quantity. In this case, the limiting reactant is O₂ since there is only 100 kmol of it compared to 100 kmol of C₂H₄.

The extent of the reaction can be calculated based on the limiting reactant. Since 1 mole of O₂ reacts with 2 moles of C₂H₂, the maximum extent of the reaction (moles of O₂ consumed) will be:

Extent = 1/2 * 100 kmol = 50 kmol

Therefore, 50 kmol of O₂ will be consumed in the reaction.

Using the stoichiometry, we can determine the moles of C₂H₄O produced. Since 2 moles of C₂H₂ produce 2 moles of C₂H₄O, and the extent of the reaction is 50 kmol, the moles of C₂H₄O formed will be:

Moles of C₂H₄O = 2 * 50 kmol = 100 kmol

So, the product will contain 50 kmol of O₂ and 100 kmol of C₂H₄O. The correct answer is: 50 kmol, 100 kmol, 100 kmol O₂.

To know more about Chemical Equation related question visit:

https://brainly.com/question/28792948

#SPJ11

with step-by-step solution
22. A mixture of 0.66g of camphor and 0.05g of an organic solute freeze at 157°C. If the solute contains 10.5% H by weight, determine the molecular formula of the solute if the freezing point of camp

Answers

The molecular formula of the solute is C₂H₆O₂ (acetic acid). To determine the molecular formula of the solute, we need to consider the freezing point depression caused by the solute in the camphor. The depression in the freezing point is related to the molality of the solute.

The molality (m) can be calculated using the formula:

m = (ΔTf) / Kf

Where:

ΔTf is the freezing point depression (in this case, 157°C - 0°C = 157°C)

Kf is the cryoscopic constant of the solvent (camphor)

The molality can also be calculated as:

m = (moles of solute) / (mass of solvent in kg)

We know that the mass of camphor is 0.66g and the mass of the solute is 0.05g. To determine the moles of solute, we need to calculate the moles of hydrogen (H) in the solute.

The mass of hydrogen in the solute is given as 10.5% of the solute's total mass:

Mass of H = 10.5% of 0.05g = 0.00525g

To convert the mass of hydrogen to moles, we use the molar mass of hydrogen (1 g/mol):

Moles of H = (Mass of H) / (Molar mass of H)

= 0.00525g / 1 g/mol

= 0.00525 mol

Since the solute contains only one hydrogen atom, the moles of solute is also equal to the moles of hydrogen.

Now, we can calculate the molality (m) using the given freezing point depression:

m = (ΔTf) / Kf

= 157°C / Kf

Since the molality is also equal to the moles of solute divided by the mass of the solvent in kg, we can set up the equation:

m = (moles of solute) / (mass of solvent in kg)

Using the given masses of camphor and solute:

m = 0.00525 mol / (0.66g / 1000g/kg)

≈ 7.95 mol/kg

To determine the molecular formula, we need to find the empirical formula first. The empirical formula represents the simplest whole number ratio of atoms in the compound.

In this case, the empirical formula will be C₂H₆O₂, which corresponds to acetic acid.

The molecular formula of the solute is C₂H₆O₂ (acetic acid).

To know more about acetic , visit;

https://brainly.com/question/32903058

#SPJ11

3. Given the formulas for two compounds:

H H H H
| | | |
H-C-C-O-C-C-H
| | | |
H H H H

And

H H H H
| | | |
H-C-C-C-C-H
| | | |
H H H H

These compounds differ in
(1) gram-formula mass
(2) molecular formula
(3) percent composition by mass
(4) physical properties at STP

Answers

Answer:

The compounds differ in (2) molecular formula.

Explanation

The molecular formula represents the actual number and types of atoms present in a molecule. In the given compounds, the arrangement of atoms is different, resulting in different molecular formulas.

The first compound is an organic molecule with a central oxygen atom (O) bonded to two carbon atoms (C) and two hydrogen atoms (H) on each side. Its molecular formula is C2H6O.

The second compound is an organic molecule with a chain of four carbon atoms (C) and 10 hydrogen atoms (H). Its molecular formula is C4H10.

Therefore, the compounds differ in their molecular formulas, as the arrangement and number of atoms are distinct. The other options mentioned, such as gram-formula mass, percent composition by mass, and physical properties at STP, may vary between compounds but are not the factors that differentiate these specific compounds in this context.

Combustion A gaseous hydrocarbon fuel (CxH2x+2) is combusted with air in an industrial furnace. Both the fuel and air enter the furnace at 25°C while the products of combustion exit the furnace at 227°C. The volumetric analysis of the products of combustion is: Carbon dioxide (CO₂) 9.45% Carbon monoxide (CO) 2.36% Oxygen (O₂) 4.88% Nitrogen (N₂) 83.31% Write a balanced chemical equation for the combustion reaction (per kmol of fuel) and hence determine the fuel and the air-fuel ratio. Construct separate 'reactants' and 'products' tables giving the number of moles and molar enthalpies for each of the reactants and products, respectively, involved in the combustion process. Hence determine the heat transfer rate and the combustion efficiency on a lower heating value (LHV) basis.

Answers

The balanced chemical equation for the combustion reaction of the gaseous hydrocarbon fuel (CxH2x+2) with air can be written as CxH2x+2 + (2x + 1)O2 + 3.76N2 -> xCO2 + (x + 1)H2O + 3.76(2x + 1)N2. The fuel is determined to be methane (CH4).

The balanced chemical equation for the combustion reaction of the gaseous hydrocarbon fuel (CxH2x+2) with air can be written as:

CxH2x+2 + (2x + 1)O2 + 3.76N2 -> xCO2 + (x + 1)H2O + 3.76(2x + 1)N2.

Given the volumetric analysis of the products of combustion, we can determine the value of x in the hydrocarbon fuel. The percentage of carbon dioxide (CO2) corresponds to the carbon atoms in the fuel, so 9.45% CO2 implies x = 1. The fuel is therefore methane (CH4).

To calculate the air-fuel ratio, we compare the moles of air to the moles of fuel in the balanced equation. From the equation, we have (2x + 1) moles of oxygen (O2) and 3.76(2x + 1) moles of nitrogen (N2) for every 1 mole of fuel. Substituting x = 1, we find that the air-fuel ratio is 17.2 kg of air per kg of fuel.

To determine the heat transfer rate and combustion efficiency on a lower heating value (LHV) basis, we need to calculate the molar enthalpies of the reactants and products. Using standard molar enthalpies of formation, we can calculate the change in molar enthalpy for the combustion reaction. The heat transfer rate can be obtained by multiplying the change in molar enthalpy by the mass flow rate of the fuel. The combustion efficiency on an LHV basis can be calculated by dividing the actual heat transfer rate by the ideal heat transfer rate.

Learn more about hydrocarbon  : brainly.com/question/30666184

#SPJ11

2. Consider a spherical tank stored with hydrogen (species A) at
10 bar and 27ᵒC. Tank is made of steel (species B) and its diameter
and thickness are 100 and 2 mm., respectively. The molar
concentr

Answers

The molar concentration of hydrogen in the spherical tank is 40.2 mol/m³.

The molar concentration of hydrogen (species A) in a spherical tank made of steel (species B) can be calculated as follows:

Given data:

The diameter of the spherical tank is 100 mm.

The thickness of the tank is 2 mm.

The pressure of hydrogen in the tank is 10 bar.

The temperature of hydrogen in the tank is 27°C.

The density of steel is 7.86 g/cm³.

The molecular weight of hydrogen is 2 g/mol.

Formula: The molar concentration (n/V) of hydrogen is given by n/V = P/(RT)where,

P is the pressure of hydrogen in the tank

R is the gas constant

T is the temperature of hydrogen in the tank (in K)

V is the volume of the tank

Solution: Let us first calculate the volume of the tank.

The diameter of the spherical tank = 100 mm

So, the radius of the tank, r = diameter/2 = 100/2 = 50 mm = 0.05 m

The thickness of the tank = 2 mm

So, the inner radius of the tank, R1 = r - t = 0.05 - 0.002 = 0.048 m

The outer radius of the tank, R2 = r = 0.05 m

Now, the volume of the spherical tank, V = 4/3π(R2³ - R1³) = 4/3π(0.05³ - 0.048³) = 8.08×10⁻⁵ m³

The temperature of hydrogen in the tank = 27°C = 300 K

The pressure of hydrogen in the tank = 10 bar = 1×10⁶ Pa

The gas constant, R = 8.314 J/K·mol

The molecular weight of hydrogen, M = 2 g/mol = 0.002 kg/mol

Now, the molar concentration of hydrogen ,n/V = P/(RT)= (1×10⁶)/(8.314×300) = 40.2 mol/m³

Know more about here:

https://brainly.com/question/30284139

#SPJ11

Henry's law may be expressed in different ways and with different concentration units, resulting in different values for the Henry's law constants. If mole fraction is used as the concentration unit, one algebraic statement of the law is: Pgas KHXgas where k is the Henry's law constant in units of pressure, usually atm. At 25°C, some water is added to a sample of gaseous arsine (AsH3) at 3.68 atm pressure in a closed vessel and the vessel is shaken until as much arsine as possible dissolves. Then 0.962 kg of the solution is removed and boiled to expel the arsine, yielding a volume of 0.813 L of AsH3(g) at 0°C and 1.00 atm. Determine the Henry's law constant for arsine in water based on this experiment. atm

Answers

The Henry's law constant for arsine in water based on this experiment is 4.27 atm.

Henry's law is a gas law which explains that the amount of a gas which is dissolved in a liquid is directly proportional to the pressure of the gas above the liquid, provided the temperature is constant. Henry's law may be expressed in different ways and with different concentration units, resulting in different values for the Henry's law constants.

One algebraic statement of the law is: Pgas KHXgas where k is the Henry's law constant in units of pressure, usually atm.

At 25°C, some water is added to a sample of gaseous arsine (AsH3) at 3.68 atm pressure in a closed vessel and the vessel is shaken until as much arsine as possible dissolves. Then 0.962 kg of the solution is removed and boiled to expel the arsine, yielding a volume of 0.813 L of AsH3(g) at 0°C and 1.00 atm.

The given parameters are:Pgas = 3.68 atm; x = ?; m = 0.962 kg; Vg = ?; Pg = 1 atm; T = 273 K; VH2O = 0.962 kg / (18.01528 g/mol) = 53.43 mol.The gas moles at 25°C are calculated from: PV = nRT where V is the volume of the gas in liters, P is the pressure of the gas in atm, n is the number of moles of gas, R is the gas constant (0.082 L·atm/K·mol), and T is the temperature in kelvin. Using these values, the number of moles of arsine gas (AsH3) in the sample is:Pgas = nRT/Vn = (Pgas x V) / RTn = (3.68 atm x VH2O) / (0.082 L·atm/K·mol x 298 K) = 14.18 mol of AsH3 gas in the sample.

Using the mass of the solution, the number of moles of AsH3 in the solution can be determined:mass fraction AsH3 in solution = mass AsH3 / mass of solution; mass AsH3 = mass of solution × mass fraction AsH3 in solution = 0.962 kg × xmass fraction AsH3 in solution = (mass AsH3 / mass of solution) = 53.43 mol AsH3 / (53.43 mol + n(H2O) ) = x/1000where n(H2O) is the number of moles of water and x is the mole fraction of AsH3 in the solution.

Hence,53.43 / (53.43 + n(H2O)) = x / 1000, which yields x = 62.75 mole percent

The mole fraction of AsH3 in solution is:x = 0.6275 mol AsH3 / (0.3725 mol H2O + 0.6275 mol AsH3) = 0.6275 / 1.000 = 0.6275

The partial pressure of AsH3 is given by:PH2O = 1 atm (since AsH3 is boiled and collected at 1 atm)PAsH3 = Ptot - PH2O

where Ptot = 3.68 atm is the total pressure of the system.

Therefore,PAsH3 = 3.68 atm - 1 atm = 2.68 atmNow, using the Henry's law equation: Pgas = K HXgas, we can solve for K (Henry's law constant),K = Pgas / XH2OK = 2.68 atm / 0.6275 = 4.27 atm (rounded to two decimal places).

Therefore, the Henry's law constant for arsine in water based on this experiment is 4.27 atm.

Learn more about Henry's law here,

https://brainly.com/question/4931344

#SPJ11

1. Distinguish between: a) Metallic conduction and electrolytic con- duction. b) Standard electrode potential and corro- sion potential. c) Anode and cathode. d) Electronic conduction and ionic conduc

Answers

a) Metallic conduction and electrolytic conduction: Metallic conduction is the flow of electric current in metals due to the movement of delocalized electrons, while electrolytic conduction is the flow of electric current in electrolytes through the movement of ions.

a) Metallic conduction occurs in metals, where there is a sea of delocalized electrons that are free to move throughout the material. When a potential difference is applied across the metal, these electrons drift in the direction of the electric field, resulting in the flow of electric current. Metallic conduction is characterized by the movement of electrons, which are negatively charged particles.

On the other hand, electrolytic conduction occurs in electrolytes, which are solutions containing ions. When an electrolyte is placed in an electric field, the positive ions (cations) migrate towards the negative electrode (cathode), while the negative ions (anions) migrate towards the positive electrode (anode). This movement of ions results in the flow of electric current through the solution. Electrolytic conduction is characterized by the movement of ions, which are charged particles.

metallic conduction involves the movement of electrons in metals, while electrolytic conduction involves the movement of ions in electrolytes.

Learn more about cathode : brainly.com/question/11920555

#SPJ11

Ethylene gas and water vapor at 320°C and atmospheric pressure are fed to a reaction process as an equimolar mixture. The process produces ethanol by reaction: C₂H4(g) + H₂O(g) → C₂H5OH(1) Wh

Answers

The limiting reactant in the given reaction process, where ethylene gas (C₂H₄) and water vapor (H₂O) react to produce ethanol (C₂H₅OH), is water vapor (H₂O).

To determine the limiting reactant, we compare the stoichiometric ratio of the reactants to the actual ratio in the equimolar mixture. The balanced equation for the reaction is:

C₂H₄(g) + H₂O(g) → C₂H₅OH(l)

From the equation, we can see that the stoichiometric ratio of ethylene to water is 1:1. However, since the mixture is given as equimolar, it means that the actual ratio of ethylene to water is also 1:1.

The concept of limiting reactant states that the reactant that is completely consumed or runs out first determines the amount of product formed. In this case, since the ratio of ethylene to water is equal in the equimolar mixture, the limiting reactant will be the one that is present in the least amount, and that is water vapor (H₂O).

In the given reaction process where ethylene gas (C₂H₄) and water vapor (H₂O) react to produce ethanol (C₂H₅OH), water vapor is the limiting reactant. This means that the amount of ethanol produced will be determined by the availability of water vapor. To optimize the reaction and increase the yield of ethanol, it would be necessary to ensure sufficient water vapor is present or to adjust the reactant ratios accordingly.

To know more about limiting reactant, visit

https://brainly.com/question/26905271

#SPJ11

Other Questions
I WILL GIVE BRAINLIEST Why did the South secede from the United States?When was the period of Reconstruction? Why did it fail? Use Simulink to simulate the following circuit. Save your slx.file as EE207_StudentID. 1. Find the power developed by the 20 V source in the circuit in Figure 1. 35 i 202 1 402 www m + es 20 V i 40 02 8002 3.125 2002 Figure 1 20 Ohm 2 Ohm 1 Ohm 20 V f(x)=0 40 Ohm www 4 Ohm 80 Ohm A thin lens with a focal length of +10.0 cm is located 2.00 cm in front of a spherical mirror with a radius of -18.0 cm. Find (a) the power, (b) the focal length, (c) the principal point, and (d) the focal point of this thick-mirror optical system. Which are correct representations of the inequality 3(2x 5) < 5(2 x)? Select two options.x < 56x 5 < 10 x6x + 15 < 10 5xA number line from negative 3 to 3 in increments of 1. An open circle is at 5 and a bold line starts at 5 and is pointing to the right.A number line from negative 3 to 3 in increments of 1. An open circle is at negative 5 and a bold line starts at negative 5 and is pointing to the left. If the highest frequency of a baseband signal is fi, write down the corresponding bandwidth of the modulated signal in AM, DSB, SSB, VSB system respectively. 6. Draw the principle models of DSB signal generation and demodulation. Geriatric depressionWhy might mind-body intervention a useful alternative to talk therapy in older adults with depression?What are the risk factors of geriatric depression?What factors predict good (or bad) treatment outcomes in geriatric depression? 1. Four identical stationary point charges (q=+1 nC = nanoCoulomb) are placed at P(x = 0, y = -2 cm, z = 0), P (0, +2 cm, 0), P3 (0, 0, -2 cm), and P (0, 0, +2 cm) in a cartesian coordinate system. The charges are surrounded by air. Find the total electric force E tot acting on a +1 nC charge located at Pobservation (+2 cm, 0, 0). (a) Draw a simple sketch of this charge configuration. Find the total electric force FE tot acting on a +1 (nC nanoCoulomb) charge located at Pobservation (+2 cm, 0, 0). = (b) Calculate and electric field vector Etot at Pobservation- (c) Now change the charge at Pobservation to -2 nC and repeat parts (a) and (b) of this problem. (d) State in your own words the definition of the electric field? What does this tell you about the calculations of the electric field that you made in the two previous cases? (e) State in your own words the definition of the magnetic field. Is it applicable to this problem? Why or why not? LION For purposes of human interaction, particularly in negotiation, the two most important Jungian personality facets are: Our cognitive processing style and the way we interact with the world. Our personal source of energy and the way we interact with the world. Our manner of taking in information and the way we interact with the world. Our manner of taking in information and our cognitive processing style. . For the transistor amplifier shown in Fig, R, 39 k2, R -3.9 k2, Re 1.5 k2, R = 400 52 and R = 2 ks2.(i) Draw d.c. load line (ii) Determine the operating point (iii) Draw a.c. load line. Assume VBE = 0.7 V. +Vcc=15 V RC Ce HH R wwww a www www 3 www HF wwwwww famuord racistance rc 50 is used for Ahhhh! Please help!!!!! 3.A ball of mass 0.8 Kg is dragged in the upward direction on aninclined plane.Calculate the potential energy gained by this ballat a height of the wedge of 0.2 meter.please help. thank u Company a charges a $100 annual fee plus a $9/hr car share fee. Company B charges $120 plus $7/hr. What is the minimum number of hours that a car share needs to be used per year to make company B a better deal? How much work must be done (and inwhat direction) in kJ if a system loses 481 cal of heat but gains289 cal of energy overall? Task 4: Complete the Deck Create a class, Deck, that encapsulates the idea of deck of cards. We will represent the deck by using an array of 52 unique Card objects. The user may do two things to do the deck at any time: shuffle the deck and draw a card from the top of the deck. Requirements FIELDS Deck cards: private Card cards top: private int top Deck(): public Deck() draw(): public Card draw() getTop(): public int getTop() shuffle(): public void shuffle() toString(): public java.lang.String to String() Figure 3. UML Functionality Default Constructor o Instantiate and initialize cards with 52 Card CONSTRUCTORS METHODS DeckClient.java public class DeckClient { public static void main(String [] args) { System.out.println("-. Creating a new Deck"); Deck d = new Deck(); System.out.println(d); System.out.println("Top of deck: " + d.getTop()); System.out.println(". Shuffling full deck"); d. shuffle(); System.out.println(d); System.out.println("Top of deck: "1 d.getTop()); System.out.println("- Drawing 10 cards"); for (int i = 0; i Assume that the following loop is executed on a MIPS processor with 16-word one-way set-associative cache (also known as direct mapped cache). Assume that the cache is initially empty. addi $t0,$0, 6 beq $t0,$0, done Iw $t1, 0x8($0) Iw $t2, 0x48($0) addi $t0,$t0, -2 j loop done: 1. Compute miss rate if the above piece of code is executed on the MIPS processor with 16-word direct mapped cache. 2. Assume that the 16-word direct mapped cache into an 16-word two-way set-associative cache. Re-compute miss rate if the above piece of code is executed on the MIPS processor with 16-word direct mapped cache. the NEW HDI is created from combining a number of different indices as described in the textbook. the value of each sub-index used in the creation of the HDI is created using a dimension index. Calculate the Dimension index if the Actual Value=8.5 , The Minimum Value=4.0 and the Maximum value=19.3 Which one of the following is the factor of mental processes? a. Personality b. Attention c. Motivation O d. Emotion Discuss three (3) challenges facing HR today. 1.(a) If Inverse Demand is P=17.814.34QP=17.814.34Q, what is the equation for the price-elasticity of demand? (Round to two decimals if necessary.)(b) If the price is 7.21, what is the elasticity?(c) Therefore when the price is 7.21, demand is