Step-by-step explanation:
Basically the question is asking how many multiples of 5 there are in the range 1000\leq x \leq 9999
Answer: 400000 numbers
the number we need is abcdef (a ≠ 0)
becauuse abcdef > 199999 and it is a multiple of 2.
=> 200000 ≤ abcdef ≤ 999998
=> there are: (999998 - 200000)/2 + 1 = 400000 (numbers)
Step-by-step explanation:
What is the expression shown
Answer:
There is nothing but your question and you should try on your own
Step-by-step explanation:
Answer:
N/A
Step-by-step explanation:
There is not context with this problem, therefore it cannot be solved.
A group of 3 friends are practicing for a track meet. The group is going to run 7 12 miles total. If they each run the same distance, how far will each person run?
For full points:
1) Show your thinking step by step on how you solved this problem.
2) Do not forget to include the final answer.
pls hurry ;-;
1) Graph the quadratic function given in standard form and identify the key features. Include at least 5 points on your
graph.
y=-x²-2x +1
Axis of Symmetry:
Vertex:
Y-intercept:
Domain:
Range:
Just question one plz help ASAP
Answer:
14
Step-by-step explanation:
the diagram shows two parallel lines cut by a transversal. If the measure of < 3 = ( 7y + 15) and the measure of < 5 = ( 110 - 2y) , what is the measure of <4
Step-by-step explanation:
Angle 3 + Angle 5 = 180° (C-angles)
Therefore 7y + 15 + 110 - 2y = 180, 5y = 55, y = 11.
Angle 4 = Angle 5 (Z-angles)
Hence Angle 4 = 110 - 2y = 110 - 2(11) = 88°.
TRAVEL It is about 350 miles from Ruidoso, New Mexico, to Abilene, Texas. Haruko has already driven 75 miles and made it to Roswell, New Mexico. She hopes to finish the rest of her trip, including stops, in 5 hours. Write an equation to find the average speed Haruko needs to drive to finish the rest of her trip in 5 hours.
Answer:
55 mph
Step-by-step explanation:
Given that:
Total miles of journey = 350 miles
Miles already driven = 75 miles
To cover the rest of the journey in 5 hours, the average speed of travel. Will be:
Recall:
Speed = (Distance left to cover ÷ budgeted travel time)
Distance left to cover : (total miles - distance already driven)
Average speed required = (350 - 75) / 5
= 275 / 5
= 55 mph
Round 3292.53429 to the nearest hundred thousandth
Answer:
The answer is "0.00001"
Step-by-step explanation:
Given value:
[tex]\to 3292.53429[/tex]
when we round a hundred thousandths (100,000) value. So, the given rounding 3292.53429 to the nearest 0.00001.
Explain it too and is it x method?
Consider the following triangle side lengths and determine if the triangle could exist. Justify your answer. Part A: 21,18,17 Part B: 3,12,8
Answer:
A yes, B no
Step-by-step explanation:
The triangle inequality states that the sum of any 2 sides of the triangle must be greater than the third side.
A Given 21, 18, 17 , then
21 + 18 = 39 > 17
21 + 17 = 38 > 18
18 + 17 = 35 > 21
Thus the triangle could exist
B Given 3, 12, 8 , then
3 + 12 = 9 > 8
3 + 8 = 11 < 12 ← fails the test
Thus the triangle does not exist
A line is perpendicular to y = 3x - 8
and intersects the point (2,2).
What is the equation of this
perpendicular line?
Since the line is perpendicular, we know that the slope is reciprocal and negative to the other one.
So,
y = -4x + b
We want to find the y-intersect (b) so substitute the intersected points and solve for it.
2 = -4(2) + b
2 = -8 + b
2 + 8 = b
10 = b
So the complete equation would be:
y = -4x + 10
help!!
Find the solution of the system of equations
shown on the graph.
Answer:
(0,6)
Step-by-step explanation:
When a system of equations is graphed, the point at which the lines intersect is a solution to the system. Looking at the graph, we can see that the lines intersect at (0,6). Therefore, (0,6) is a solution to the system of equations.
|-4/5-1/10| + |-3/4+5/2|
A.) 9/10
B.) 53/20
C.) 7/4
D.) 17/10
Answer:
B.) 53/20
General Formulas and Concepts:
Pre-Algebra
Order of Operations: BPEMDAS
Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to RightAlgebra I
|Absolute Value| makes any negative number positiveStep-by-step explanation:
Step 1: Define
|-4/5 - 1/10| + |-3/4 + 5/2|
Step 2: Evaluate
Subtract: |-9/10| + |-3/4 + 5/2|Add: |-9/10| + |7/4|Absolute Value: 9/10 + 7/4Add: 53/20Express 0.000000000936 in
scientific notation.
9.36x10
Enter
Answer:
9.36 x 10^(-10)
Step-by-step explanation:
Line A passes through points (2, 9) and (7, 3). Line B passes through points (1, 4) and (7, 9). Are line A and line B parallel or perpendicular?
Express 27 4/3 in simplest radical form
Answer:
3⁴
Step-by-step explanation:
Expressing in the simplest radical form means simplifying a radical so that there are no more square roots, cube roots, fourth roots etc.
It further means removing radicals in the denominator of a fraction.
Given
[tex]27^{4/3}[/tex]
this can be written as
[tex](\sqrt[3]{27} )^{4}[/tex]
This is simplified as;
(3)⁴
What is the interval notation for the compound inequality? x≤−4 or x≥5
(−∞, −4) or (5, ∞)
(−∞, −4] or [5, ∞)
(−4,5)
[−4,5]
Answer:
(-∞, -4] or [5, ∞)
Step-by-step explanation:
Because the solutions for x can also be equal to -4 and 5, brackets are used.
And because the solutions for x can be any number less than -4 or any number greater than 5, -∞ and ∞ are used respectively.
it takes 12 people to pull 30 tons of goods how many people would it take to pull 60 tons of goods
Answer:
24
Step-by-step explanation:
60 is double of 30 so double 12 to get your answer, 12 time two is 24
In the figure, point C is the midpoint of (A/E) Use the figure to answer the questions.
Avery says that AbC /DeC by the ASA congruence postulate. Do you agree or disagree Explain?
Suppose it is also known that point C is also the midpoint of (B/D Which postulate or theorem can be used to prove that aBC/DeC? Justify your answer.
Answer:
Disagree ΔABC ≅ ΔDEC by ASA butt by SAS
Step-by-step explanation:
point C is the midpoint of (A/E), C is also the midpoint of (B/D )
BC = CD and AC = CE
∠BCA = ∠ECD
ΔABC ≅ ΔDEC by SAS not by ASA
Rewrite in simplest terms: (10x + y) + (10x – 7y)
Oh
9514 1404 393
Answer:
20x -6y
Step-by-step explanation:
Parentheses can be eliminated and like terms combined.
10x +y +10x -7y
= x(10 +10) +y(1 -7)
= 20x -6y
I thought of a number. I divided that number by 4 and added 6 to it. The result was 8. What was my number?
Btw this is supposed to be a fun-like math question :)
Answer:
8
Step-by-step explanation:
x÷4+6=8 x=8loooooooooooooooooooooooooooooooooooool
Help me on this math problem please! I’ve been stuck on it for 15 mins now
Answer:
Step-by-step explanation:
P = perimeter = 114
P =2 * length +2* width
P = 2(2x - 3) + 2(x)
114 = 4x-6 + 2x
114 = 6x -6
19 = x -1
20 = x
check it
2( 2x -3)+2x = ?
4x -6 +2x=?
6x -6 = ?
6(20)-6 =?
120-6 = 114
yep this is correct
the total distance that fred amy and leah need to drive is 180 miles. fred will drive 65 miles and leah will drive 45 miles. how many miles will amy need to drive
Answer:
Amy needs to drive 70 miles.
Step-by-step explanation:
180-(65+45)=?
180-(110)=70
Have no idea how to do this lok
Answer:
that hard
Step-by-step explanation:
Answer Plz, ASAP. Within 10 minutes will be Marked as Brainliest
[tex] \sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=?[/tex]
[tex]\large\bold{\underline{\underline{Explanation:-}}}[/tex]They are asking us to find the determinant
[tex]\boxed{\sf \left|\begin{array}{c c} a & b \\ c & d \end{array}\right| =ad-bc}[/tex]
Now using the above formula it becomes[tex]\left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right| \: = sin20 \degree cos70 \degree - ( - cos20 \degree sin70 \degree) \: \\ \\ = sin20 \degree cos70 \degree + cos20 \degree sin70 \degree [/tex]
Now using the formula[tex]\boxed{\sf sin(A+B)=sinAcosB+cosAsinB}[/tex]
it becomes
[tex] \longrightarrow \: sin(20 + 70) \\ \\ \longrightarrow \: sin(90 \degree) = 1[/tex]
★Therefore[tex] \boxed{\sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=1}[/tex]
━━━━━━━━━━━━━━━━━━━★Extra information:-What is a matrix?☄It is a rectangular representation or array of numbers,symbols and many more functions
☄It is represented in rows and columns
━━━━━━━━━━━━━━━━━━━━━━━━━━think of an event that might occur at three different speeds and describe it.
Answer:
tornado!
Step-by-step explanation:
sometimes tornados can start off slow and sometimes they can go really fast.
PLEASE HELP
f(x) = x2. What is g(x)?
Answer: Choice C. g(x) = (3x)^2
To confirm this, plug in x = 1 and you'll find that:
g(x) = (3x)^2
g(1) = (3*1)^2
g(1) = (3)^2
g(1) = 3*3
g(1) = 9
Showing that (1,9) is on the red g(x) curve.
Find the y-intercept and x-intercept of the line.
5x-3y=10
Answer:
strategy: put this equation into slope intercept form y = mx + b
then it is easier to find x and y intercepts
Step-by-step explanation:
5x-3y=10
5x-10=3y
5/3x - 10/3 = y
y = 5/3x - 10/3
when x is zero then y is - 10/3, that's the y intercept
when y is zero then x is 2, that's the x intercept
:)
What is the solution to the system below?
y = -3x - 2
6x + 2y = -4
Answer:
Infinitely many solutions
Step-by-step explanation:
Since y=-3x-2, plug it in (2)
6x+2(-3x-2)=-4.
Distribute:
6x-6x-4=-4
-4=-4
Infinetly many solutions.
Hope this helps :)
HELPP! Find the y-intercept of the line on the graph.
Enter the correct answer
Answer:
-2
Step-by-step explanation:
The y-intercept of the line is -2
Answer:
-2
Step-by-step explanation:
because the line is on the -2 on the y axis
A classroom is 11 m long, 8 m wide and 5.5 m high Find the sum of the areas of the four walls.
( please show the working out pleaseee)
Answer:
209 m²
Step-by-step explanation:
The class room has a measurement of 11 m long, 8 m wide and 5.5 m high. Hence the walls of the classroom would be 4, with the following measurements.
Wall 1: 11 m by 5.5 m, Wall 2: 8 m by 5.5 m, Wall 3: 11 m by 5.5 m and Wall 4: 8 m by 5.5 m
The area of wall 1 = 11 m * 5.5 m = 60.5 m²
The area of wall 2 = 8 m * 5.5 m = 44 m²
The area of wall 3 = 11 m * 5.5 m = 60.5 m²
The area of wall 4 = 11 m * 5.5 m = 44 m²
The sum of areas of the fall wall = area of wall 1 + area of wall 2 + area of wall 3 + area of wall 4
The sum of areas of the fall wall = 60.5 + 44 + 60.5 + 44 = 209 m²
PLEASE HELP ASSP !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
Answer:
A: 2/9
Step-by-step explanation: